CAS 2672-58-4: Trimethyl 1,3,5-benzenetricarboxylate
Description:Trimethyl 1,3,5-benzenetricarboxylate, with the CAS number 2672-58-4, is an organic compound belonging to the class of aromatic carboxylic acid esters. It features a benzene ring substituted with three carboxylate groups, each esterified with a methyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its solubility in organic solvents, such as ethanol and acetone, while being less soluble in water due to its hydrophobic aromatic structure. Trimethyl 1,3,5-benzenetricarboxylate is often utilized in organic synthesis, particularly in the production of various esters and as a building block in the synthesis of more complex molecules. Its chemical properties include the ability to undergo hydrolysis, transesterification, and other reactions typical of esters. Additionally, it may exhibit low toxicity, but safety precautions should be taken when handling it, as with all chemical substances.
Formula:C12H12O6
InChI:InChI=1S/C12H12O6/c1-16-10(13)7-4-8(11(14)17-2)6-9(5-7)12(15)18-3/h4-6H,1-3H3
InChI key:InChIKey=RGCHNYAILFZUPL-UHFFFAOYSA-N
SMILES:O=C(OC)C=1C=C(C=C(C1)C(=O)OC)C(=O)OC
- Synonyms:
- 1,3,5-Benzenetricarboxylic acid trimethyl ester
- 1,3,5-Benzenetricarboxylic acid, 1,3,5-trimethyl ester
- 1,3,5-Tri(methoxycarbonyl)benzene
- 1,3,5-Tricarbomethoxybenzene
- 1,3,5-Trimethyl benzene-1,3,5-tricarboxylate
- 1,3,5-Tris(methoxycarbonyl)benzene
- Benzene-1,3,5-Triyl Triacetate
- NSC 61883
- Trimesic acid trimethyl ester
- Trimethyl Cyclohexane-1,3,5-Tricarboxylate
- See more synonyms
- Trimethyl Trimesate
- Trimethyl benzene-1,3,5-tricarboxylate
- Trimethyl 1,3,5-benzenetricarboxylate
