CAS 2672-63-1: 1,6-Anhydro-4-O-alpha-D-glucopyranosyl-D-glucopyranose

Description: 1,6-Anhydro-4-O-alpha-D-glucopyranosyl-D-glucopyranose, with the CAS number 2672-63-1, is a carbohydrate compound that features a unique structure characterized by an anhydro linkage between two glucopyranose units. This compound is a derivative of glucose and is notable for its glycosidic bond, which contributes to its stability and solubility in water. It typically appears as a white to off-white crystalline solid and is soluble in polar solvents due to its hydroxyl groups. The presence of the anhydro linkage imparts specific properties, such as resistance to hydrolysis compared to its non-anhydro counterparts. This compound is of interest in various fields, including biochemistry and food science, due to its potential applications in the development of functional foods and as a prebiotic. Its structural characteristics also make it a subject of study in glycoscience, where understanding its behavior and interactions can lead to insights into carbohydrate chemistry and metabolism.

Formula: C₁₂H₂₀O₁₀

InChI: InChI=1/C12H20O10/c13-1-3-5(14)6(15)8(17)12(20-3)22-10-4-2-19-11(21-4)9(18)7(10)16/h3-18H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11?,12-/m1/s1

Maltosan

CAS: 2672-63-1

1,6-Anhydro-4-O-α-D-glucopyranosyl-D-glucopyranose

CAS: 2672-63-1

Please enquire for more information about 1,6-Anhydro-4-O-alpha-D-glucopyranosyl-D-glucopyranose including the price, delivery time and more detailed …

• Formula: C₁₂H₂₀O₁₀
• Purity: Min. 95%
• Molecular weight: 324.28 g/mol