CAS 267225-27-4
:D-2-Bromophe
Description:
D-2-Bromophenylalanine, identified by its CAS number 267225-27-4, is an amino acid derivative characterized by the presence of a bromine atom attached to the phenyl group of phenylalanine. This compound typically exhibits properties associated with both amino acids and halogenated aromatic compounds. It is likely to be a white to off-white solid, soluble in polar solvents such as water and alcohols, while exhibiting limited solubility in non-polar solvents. The bromine substitution can influence its reactivity, making it useful in various chemical syntheses and biological applications, particularly in studies involving protein structure and function. Additionally, the presence of the bromine atom may impart unique spectroscopic properties, allowing for its detection and analysis through techniques such as NMR and mass spectrometry. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact. Overall, D-2-Bromophenylalanine serves as a valuable tool in both synthetic chemistry and biochemical research.
Formula:C9H10BrNO2
InChI:InChI=1/C9H10BrNO2/c10-7-4-2-1-3-6(7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m1/s1
SMILES:c1ccc(c(c1)C[C@H](C(=O)O)N)Br
Synonyms:- D-2-Bromophenylalanine
- (2R)-2-ammonio-3-(2-bromophenyl)propanoate
- 2-Bromo-D-phenylalanine
- H-D-Phe(2-Br)-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
D-2-Bromophenylalanine
CAS:Formula:C9H10BrNO2Purity:97%Color and Shape:SolidMolecular weight:244.08522-Bromo-D-phenylalanine
CAS:<p>Please enquire for more information about 2-Bromo-D-phenylalanine including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C9H10BrNO2Purity:Min. 98 Area-%Molecular weight:244.09 g/mol2-Bromo-D-phenylalanine
CAS:Formula:C9H10BrNO2Purity:98%Color and Shape:SolidMolecular weight:244.0882-Bromo-D-phenylalanine
CAS:<p>2-Bromo-D-phenylalanine is a precursor of l-DOPA, which is an amino acid that is used in the synthesis of dopamine. It is also used as a diagnostic agent for bladder cancer, where it is taken up by bladder cells and converted to radioactive 2-bromo-3′-deoxyuridine. This radioactive compound can be detected with a high performance liquid chromatography (HPLC) system. In addition, 2-Bromo-D-phenylalanine has been shown to inhibit the acid transporter in tumor cells, making it useful as an oncologic drug. 2 bromo d phenylalanine inhibits the acid transporter in tumor cells, making it useful as an oncologic drug</p>Formula:C9H10BrNO2Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:244.09 g/mol



