CAS 267243-64-1: N-(3-chloro-4-fluorophenyl)-7-(3-morpholin-4-ylpropoxy)-6-nitroquinazolin-4-amine
Description:N-(3-chloro-4-fluorophenyl)-7-(3-morpholin-4-ylpropoxy)-6-nitroquinazolin-4-amine is a synthetic organic compound characterized by its complex structure, which includes a quinazoline core, a nitro group, and various substituents that enhance its biological activity. The presence of the chloro and fluoro groups on the phenyl ring contributes to its lipophilicity and potential interactions with biological targets. The morpholine moiety is known for its ability to enhance solubility and permeability, making the compound potentially useful in medicinal chemistry. This compound may exhibit pharmacological properties, possibly acting as an inhibitor or modulator in various biological pathways. Its specific applications would depend on ongoing research and development, particularly in the fields of oncology or neurology, where quinazoline derivatives have shown promise. As with many synthetic compounds, understanding its stability, solubility, and reactivity is crucial for its application in drug development and therapeutic use.
Formula:C21H21ClFN5O4
InChI:InChI=1/C21H21ClFN5O4/c22-16-10-14(2-3-17(16)23)26-21-15-11-19(28(29)30)20(12-18(15)24-13-25-21)32-7-1-4-27-5-8-31-9-6-27/h2-3,10-13H,1,4-9H2,(H,24,25,26)

N-(3-chloro-4-fluorophenyl)-7-(3-Morpholino propoxy)-6-nitroquinazolin-4-aMine
Ref: IN-DA00BH31
1g | To inquire | ||
100mg | 227.00 € | ||
250mg | 311.00 € |

N-(3-Chloro-4-fluorophenyl)-7-(3-morpholinopropoxy)-6-nitroquinazolin-4-amine
Ref: 10-F546298
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire |

N-(3-Chloro-4-fluorophenyl)-7-(3-morpholinopropoxy)-6-nitroquinazolin-4-amine
Ref: 3D-SKA24364
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |