CAS 26725-51-9
:4-Hydroxybenzotriazole
Description:
4-Hydroxybenzotriazole (CAS 26725-51-9) is an organic compound that belongs to the class of benzotriazoles, characterized by its triazole ring fused to a benzene ring with a hydroxyl group at the para position. This compound is typically a white to light yellow crystalline solid, exhibiting good solubility in polar solvents such as water, methanol, and ethanol. It is known for its ability to act as a UV stabilizer and is commonly used in various applications, including plastics, coatings, and adhesives, to prevent degradation from ultraviolet light exposure. Additionally, 4-Hydroxybenzotriazole serves as a corrosion inhibitor and is utilized in the synthesis of other chemical compounds. Its structure allows it to effectively absorb UV radiation, thereby protecting materials from photodegradation. The compound is generally considered to have low toxicity, but safety precautions should be taken when handling it, as with any chemical substance. Overall, 4-Hydroxybenzotriazole is valued for its protective properties in numerous industrial applications.
Formula:C6H5N3O
InChI:InChI=1/C6H5N3O/c10-5-3-1-2-4-6(5)8-9-7-4/h1-3,10H,(H,7,8,9)
InChI key:InChIKey=JMTMSDXUXJISAY-UHFFFAOYSA-N
SMILES:OC1=C2C(=CC=C1)N=NN2
Synonyms:- 1H-1,2,3-Benzotriazol-7-ol
- 1H-1,2,3-benzotriazol-4-ol
- 1H-Benzotriazol-4-ol
- 1H-Benzotriazol-7-ol
- 2H-1,2,3-Benzotriazol-4-ol
- 4-Hydroxy-1H-benzotriazole
- Benzotriazol-4-ol
- 4-Hydroxybenzotriazole
- 4-Hydroxybenzotriazole 98%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1H-Benzo[d][1,2,3]triazol-4-ol
CAS:Formula:C6H5N3OPurity:97%Color and Shape:SolidMolecular weight:135.12341H-Benzo[d][1,2,3]triazol-7-ol
CAS:1H-Benzo[d][1,2,3]triazol-7-olPurity:98%Molecular weight:135.12g/mol4(7)-Hydroxybenzotriazole
CAS:Controlled Product<p>Applications 4-Hydroxybenzotriazole (cas# 26725-51-9) is a useful research chemical.<br></p>Formula:C6H5N3OColor and Shape:OrangeMolecular weight:135.124-Hydroxy-1H-benzotriazole
CAS:4-Hydroxy-1H-benzotriazole is a water-soluble, crystalline solid with a melting point of 105°C. It has the chemical formula of C7H5N3O2 and its molecular weight is 169.14 g/mol. 4-Hydroxy-1H-benzotriazole reacts with ferrocenecarboxylic acid to form an adduct that can be used as a chelate ligand for control analysis in wastewater treatment, which is important because it prevents the formation of reactive oxygen species. The redox potential of 4-hydroxybenzotriazole is -0.8 V, while its surface methodology is based on trifluoroacetic acid. The conformational properties of this compound are nitrogen atoms and redox potentials. 4-hydroxybenzotriazole has been found to be reactive toward oxidative injury in sodium carbonate solutions.END>Formula:C6H5N3OPurity:(%) Min. 95%Color and Shape:PowderMolecular weight:135.12 g/mol




