CAS 2673-19-0
:H-Asp(OtBu)-OMe . HCl
Description:
H-Asp(OtBu)-OMe·HCl, also known as t-butyl L-aspartate methyl ester hydrochloride, is a derivative of the amino acid aspartic acid. This compound features a t-butoxy (OtBu) protecting group on the carboxyl side chain, which enhances its stability and solubility in organic solvents. The methyl ester (OMe) group further modifies the carboxylic acid functionality, making it more amenable to various chemical reactions, such as peptide synthesis. The presence of hydrochloride (HCl) indicates that the compound is in its salt form, which typically improves its solubility in water and facilitates handling in laboratory settings. H-Asp(OtBu)-OMe·HCl is often utilized in peptide synthesis and other organic chemistry applications due to its reactivity and ability to serve as a building block for more complex molecules. Its characteristics include being a white to off-white crystalline solid, with a specific melting point range, and it is generally stable under standard laboratory conditions. Proper storage and handling are essential to maintain its integrity and reactivity.
Formula:C9H18ClNO4
InChI:InChI=1/C9H17NO4.ClH/c1-9(2,3)14-7(11)5-6(10)8(12)13-4;/h6H,5,10H2,1-4H3;1H/t6-;/m1./s1
SMILES:CC(C)(C)OC(=O)C[C@H](C(=O)OC)N.Cl
Synonyms:- H-Asp(OBut)-OMe*HCl
- L-Aspartic acid 4-tert-butyl 1-methyl ester hydrochloride
- L-(b-O-tert-Bu)-Asp-O-Me
- methyl tert-butyl (2R)-2-aminobutanedioate hydrochloride
- H-Asp(OtBu)-OMe・HCl
- H-Asp(Otbu)-Ome Hcl
- H-Asp(OtBu)-OMe.HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
L-Aspartic acid 4-tert-butyl 1-methyl ester hydrochloride, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C9H18ClNO4Purity:98%Molecular weight:239.70H-Asp(OtBu)-OMe · HCl
CAS:Bachem ID: 4004029.
Formula:C9H17NO4·HClPurity:> 99%Color and Shape:Whitish PowderMolecular weight:239.74-tert-Butyl 1-methyl L-aspartate hydrochloride
CAS:Formula:C9H18ClNO4Purity:97%Color and Shape:SolidMolecular weight:239.6965H-Asp(OtBu)-OMe.HCl
CAS:Formula:C9H18ClNO4Purity:95%Color and Shape:Solid, White powderMolecular weight:239.7





