CAS 26751-04-2
:2-hydroxy-3-methoxybenzamide
Description:
2-Hydroxy-3-methoxybenzamide, with the CAS number 26751-04-2, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a hydroxyl group (-OH) and a methoxy group (-OCH3) at specific positions, along with an amide functional group (-C(=O)NH2). This compound typically exhibits properties such as solubility in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The methoxy group contributes to its overall hydrophobic character, influencing its solubility and reactivity. 2-Hydroxy-3-methoxybenzamide may display biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of compounds with specific therapeutic effects. Additionally, the presence of both hydroxyl and methoxy groups can affect its reactivity and interaction with other chemical species, making it a versatile compound in various chemical contexts.
Formula:C8H9NO3
InChI:InChI=1/C8H9NO3/c1-12-6-4-2-3-5(7(6)10)8(9)11/h2-4,10H,1H3,(H2,9,11)
SMILES:COc1cccc(c1O)C(=N)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Hydroxy-3-methoxybenzamide
CAS:<p>2-Hydroxy-3-methoxybenzamide</p>Purity:95%Molecular weight:167.16g/mol2-Hydroxy-3-methoxybenzamide
CAS:<p>2-Hydroxy-3-methoxybenzamide is an organic molecule that binds to a series of receptors in the central nervous system. It is thought to be an agonist for the D2 receptor, which mediates inhibition of dopamine release from neurons. 2-Hydroxy-3-methoxybenzamide has been synthesized and shown to have high affinity for the D2 receptor, as well as other receptors in the brain. This drug has been shown to have beneficial effects on hyperactivity in rats and could be used for the treatment of Parkinson's disease or schizophrenia.</p>Formula:C8H9NO3Purity:Min. 95%Molecular weight:167.16 g/mol
