
CAS 267650-37-3
:L-Styrylalanine
Description:
L-Styrylalanine, identified by its CAS number 267650-37-3, is an amino acid derivative characterized by the presence of a styryl group attached to the alpha carbon of the alanine structure. This compound features both an amino group (-NH2) and a carboxylic acid group (-COOH), typical of amino acids, which contribute to its polar nature and solubility in water. The styryl group, which is a vinyl phenyl group, imparts unique properties, including potential for conjugation and interaction with various biological systems. L-Styrylalanine may exhibit interesting optical properties due to its chiral center, allowing for the existence of enantiomers. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in drug design and development, as well as in materials science for creating functional polymers. Additionally, the compound's reactivity can be influenced by the presence of the styryl moiety, making it a subject of interest in organic synthesis and medicinal chemistry. Overall, L-Styrylalanine represents a versatile compound with implications in various scientific fields.
Formula:C11H13NO2
InChI:InChI=1/C11H13NO2/c12-10(11(13)14)8-4-7-9-5-2-1-3-6-9/h1-7,10H,8,12H2,(H,13,14)/b7-4+/t10-/m0/s1
Synonyms:- (S)-2-Amino-5-phenylpent-4-enoic acid
- (2S,4E)-2-amino-5-phenylpent-4-enoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-2-Amino-5-phenylpent-4-enoic acid
CAS:(S)-2-Amino-5-phenylpent-4-enoic acidPurity:98%Molecular weight:191.23g/mol3-Styryl-L-alanine
CAS:3-Styryl-L-alanine is a synthetic petroselinic acid. It has been shown to be an inhibitor of phenylalanine ammonia-lyase, and the active site of this enzyme has been modeled by molecular modeling. Kinetic studies have shown that 3-styryl-L-alanine deaminates to form an acylated product with a higher affinity for the active site than the substrate. The ligand is rationalized by focusing on its constant, which is given by (k/K)^2 = 1/(1+constant).
Formula:C11H13NO2Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:191.23 g/molRef: 3D-FS49225
Discontinued product



