
CAS 26769-11-9
:Mycobactin S
Description:
Mycobactin S is a complex, naturally occurring siderophore produced by certain mycobacterial species, particularly Mycobacterium tuberculosis. It plays a crucial role in iron acquisition, which is vital for bacterial growth and survival, especially in iron-limited environments. Mycobactin S has a high affinity for ferric ions (Fe³⁺), facilitating the transport of iron into the bacterial cell. Structurally, it is characterized by a unique combination of peptide and hydroxamate groups, which contribute to its chelating properties. The compound is typically soluble in organic solvents and exhibits stability under various conditions, although it can be sensitive to extreme pH levels. Mycobactin S is of significant interest in microbiology and medicinal chemistry due to its role in pathogenicity and potential as a target for therapeutic interventions against mycobacterial infections. Its CAS number, 26769-11-9, is used for identification in chemical databases and regulatory contexts.
Formula:C44H69N5O10
InChI:InChI=1S/C44H69N5O10/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-28-40(52)48(56)29-22-21-26-36(46-41(53)37-32-58-42(47-37)34-24-18-19-27-38(34)50)44(55)59-33(2)31-39(51)45-35-25-20-23-30-49(57)43(35)54/h17-19,24,27-28,33,35-37,50,56-57H,3-16,20-23,25-26,29-32H2,1-2H3,(H,45,51)(H,46,53)
InChI key:InChIKey=DQMISKWZRFJSGS-UHFFFAOYSA-N
SMILES:OC1=C(C2=NC(C(NC(C(OC(CC(NC3C(=O)N(O)CCCC3)=O)C)=O)CCCCN(C(C=CCCCCCCCCCCCCCCC)=O)O)=O)CO2)C=CC=C1
Synonyms:- Mycobactin S
- L-Lysine, N2-[[(4S)-4,5-dihydro-2-(2-hydroxyphenyl)-4-oxazolyl]carbonyl]-N6-hydroxy-N6-[(2Z)-1-oxo-2-octadecenyl]-, (1S)-3-[[(3S)-hexahydro-1-hydroxy-2-oxo-1H-azepin-3-yl]amino]-1-methyl-3-oxopropyl ester
- L-Lysine, N2-[[(4S)-4,5-dihydro-2-(2-hydroxyphenyl)-4-oxazolyl]carbonyl]-N6-hydroxy-N6-[(2Z)-1-oxo-2-octadecen-1-yl]-, (1S)-3-[[(3S)-hexahydro-1-hydroxy-2-oxo-1H-azepin-3-yl]amino]-1-methyl-3-oxopropyl ester
- L-Lysine, N2-[[4,5-dihydro-2-(2-hydroxyphenyl)-4-oxazolyl]carbonyl]-N6-hydroxy-N6-(1-oxo-2-octadecenyl)-, 3-[(hexahydro-1-hydroxy-2-oxo-1H-azepin-3-yl)amino]-1-methyl-3-oxopropyl ester, stereoisomer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Mycobactin S
CAS:<p>Mycobactin S, derived from Mycobacterium phlei of sea turtles, is not made from cell remnants or dead bacteria.</p>Formula:C44H69N5O10Color and Shape:SolidMolecular weight:828.061
