CAS 26771-69-7

2-Methoxy-1-(4'-trifluoromethyl)phenylethanone

Description:

2-Methoxy-1-(4'-trifluoromethyl)phenylethanone, with the CAS number 26771-69-7, is an organic compound characterized by its distinctive functional groups. It features a methoxy group (-OCH3) and a trifluoromethyl group (-CF3) attached to a phenyl ring, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in various chemical applications, including as an intermediate in organic synthesis and potentially in pharmaceuticals. The methoxy group can participate in various chemical reactions, such as nucleophilic substitutions, while the trifluoromethyl group can stabilize certain intermediates due to its electron-withdrawing nature. Overall, 2-Methoxy-1-(4'-trifluoromethyl)phenylethanone is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₁₀H₉F₃O₂

InChI: InChI=1/C10H9F3O2/c1-15-6-9(14)7-2-4-8(5-3-7)10(11,12)13/h2-5H,6H2,1H3

SMILES: COCC(=O)c1ccc(cc1)C(F)(F)F

Synonyms:

• 2-Methoxy-1-[4-(trifluoromethyl)phenyl]ethanone
• Ethanone, 2-Methoxy-1-[4-(Trifluoromethyl)Phenyl]-

Ethanone, 2-methoxy-1-[4-(trifluoromethyl)phenyl]-

CAS: 26771-69-7

Formula: C₁₀H₉F₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 218.1725

Ref: IN-DA00I52C

2-Methoxy-1-(4-(trifluoromethyl)phenyl)ethanone

CAS: 26771-69-7

2-Methoxy-1-(4-(trifluoromethyl)phenyl)ethanone

Purity: ≥95%

Molecular weight: 218.17g/mol

Ref: 54-PC448024