CAS 26774-88-9: (αR)-α-Amino-1,4-cyclohexadiene-1-acetic acid
Description:(αR)-α-Amino-1,4-cyclohexadiene-1-acetic acid, with CAS number 26774-88-9, is an organic compound characterized by its amino acid structure, featuring a cyclohexadiene ring. This compound exhibits both acidic and basic properties due to the presence of the carboxylic acid group and the amino group, making it a zwitterionic species in solution. The cyclohexadiene moiety contributes to its unique reactivity and potential for undergoing various chemical transformations, such as electrophilic addition reactions. The stereochemistry indicated by the (αR) designation suggests a specific spatial arrangement of atoms, which can influence its biological activity and interactions with other molecules. This compound may be of interest in pharmaceutical research, particularly in the development of novel therapeutic agents, due to its structural features that could mimic natural amino acids. Additionally, its solubility and stability in different solvents can vary, affecting its applications in synthesis and biological studies. Overall, (αR)-α-Amino-1,4-cyclohexadiene-1-acetic acid represents a fascinating subject for further exploration in organic and medicinal chemistry.
Formula:C8H11NO2
InChI:InChI=1S/C8H11NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-2,5,7H,3-4,9H2,(H,10,11)/t7-/m1/s1
InChI key:InChIKey=JBJJTCGQCRGNOL-SSDOTTSWSA-N
SMILES:O=C(O)C(N)C1=CCC=CC1
- Synonyms:
- (2R)-2-Amino-2-(cyclohexa-1,4-dien-1-yl)acetic acid
- (2R)-2-Azaniumyl-2-cyclohexa-1,4-dien-1-ylacetate
- (2R)-amino(cyclohexa-1,4-dien-1-yl)ethanoic acid
- (R)-(-)-2-(2,5-Dihydrophenyl)Glycine
- (αR)-α-Amino-1,4-cyclohexadiene-1-acetic acid
- 1,4-Cyclohexadiene-1-acetic acid, α-amino-, (R)-
- 1,4-Cyclohexadiene-1-acetic acid, α-amino-, (αR)-
- 1,4-Cyclohexadiene-1-acetic acid, α-amino-, <span class="text-smallcaps">D</span>-(-)-
- <span class="text-smallcaps">D</span>-1,4-Cyclohexadienylglycine
- <span class="text-smallcaps">D</span>-2,5-Dihydrophenylglycine
- See more synonyms
- <span class="text-smallcaps">D</span>-2-(1,4-Cyclohexadienyl)glycine
- <span class="text-smallcaps">D</span>-α-Amino-1,4-cyclohexadiene-1-acetic acid
- D-(-)-Dihydro-α-phenylglycine
- D-Dihydrophenylglycine Base
- L-Dihydrophenylglycine
- 1,4-Cyclohexadiene-1-acetic acid, α-amino-, D-(-)-
- D-2-(1,4-Cyclohexadienyl)glycine
