CAS 26776-70-5
:Dihydroxyacetone dimer
Description:
Dihydroxyacetone dimer, with the CAS number 26776-70-5, is a chemical compound that is a dimer of dihydroxyacetone (DHA), a simple carbohydrate and a ketone. This substance is characterized by its molecular structure, which consists of two dihydroxyacetone units linked together. It is typically a white to off-white solid and is soluble in water due to the presence of hydroxyl groups, which can form hydrogen bonds with water molecules. Dihydroxyacetone dimer is primarily known for its role in the cosmetic industry, particularly in self-tanning products, where it reacts with amino acids in the skin to produce a bronzing effect. Additionally, it may exhibit stability under various conditions, making it suitable for formulation in various products. Its safety profile is generally favorable, but like many chemicals, it should be handled with care to avoid potential skin irritation or allergic reactions. Overall, dihydroxyacetone dimer is valued for its functional properties in both cosmetic applications and potential uses in other fields.
Formula:(C3H6O3)2
InChI:InChI=1S/C3H6O3/c4-1-3(6)2-5/h4-5H,1-2H2
InChI key:InChIKey=RXKJFZQQPQGTFL-UHFFFAOYSA-N
SMILES:C(CO)(CO)=O
Synonyms:- 1,3-Dihydroxyacetone dimer
- 2-Propanone, 1,3-dihydroxy-, dimer
- Dihydroxyacetone dimer
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,3-Dihydroxypropan-2-one dimer
CAS:Formula:C6H12O6Purity:95%Color and Shape:SolidMolecular weight:180.15591,3-Dihydroxypropan-2-one dimer
CAS:Formula:C6H12O6Purity:95.0%Color and Shape:SolidMolecular weight:180.1561,3-Dihydroxyacetone Dimer
CAS:Controlled Product<p>Applications 1,3-Dihydroxyacetone Dimer is used in the synthesis of dihydropyrimidine calcium channel blockers. Also used in the preparation of a new antineoplastic and antifilarial agents as anticancer agents.<br>References Atwal, K. et al., J. Med. Chem., 33, 1510 (1990); Ram, S. et al.: J. Med. Chem., 35, 539 (1992);<br></p>Formula:C6H12O6Color and Shape:NeatMolecular weight:180.161,3-Dihydroxyacetone dimer
CAS:<p>1,3-Dihydroxyacetone dimer is a chemical compound that absorbs ultraviolet light. It has been synthesized by reacting acetone with glyoxal in the presence of a nucleophile such as sodium hydroxide. The reaction product is then purified by chromatography and recrystallization to yield 1,3-dihydroxyacetone dimer. This compound's mechanism of action is not yet fully understood, but it may be due to its ability to form a hydrogen bond with the 5'-hydroxyl group of nucleotides or its ability to react with nucleophilic groups on DNA. This compound has been shown to cause DNA damage and inhibit cell growth in an acidic environment.</p>Formula:C6H12O6Purity:Min. 96 Area-%Color and Shape:PowderMolecular weight:180.16 g/mol





