CAS 26786-84-5
:Lomofungin
Description:
Lomofungin is a naturally occurring compound classified as a fungal metabolite, specifically derived from the fermentation of certain fungi. It belongs to the class of compounds known as polyketides, which are characterized by their complex structures and diverse biological activities. Lomofungin exhibits notable antifungal properties, making it of interest in the field of medicinal chemistry and pharmacology. Its mechanism of action typically involves the disruption of fungal cell membrane integrity, leading to cell death. The compound has been studied for its potential applications in treating fungal infections, particularly in immunocompromised patients. In terms of physical properties, Lomofungin is generally characterized by its solubility in organic solvents and limited solubility in water, which is common for many polyketides. As with many bioactive compounds, safety and toxicity profiles are crucial for its therapeutic use, necessitating further research to fully understand its pharmacokinetics and potential side effects. Overall, Lomofungin represents a significant area of interest for developing new antifungal agents.
Formula:C15H10N2O6
InChI:InChI=1S/C15H10N2O6/c1-23-15(22)6-2-3-8(19)13-11(6)16-14-10(21)4-9(20)7(5-18)12(14)17-13/h2-5,19-21H,1H3
InChI key:InChIKey=CRANETCJDDEINO-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C2=C(N=C3C(=N2)C(O)=CC(O)=C3C=O)C(O)=CC1
Synonyms:- NSC 156939
- Lomofungin
- Lomondomycin
- NSC 106995
- 1-Phenazinecarboxylic acid, 6-formyl-4,7,9-trihydroxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
