CAS 267875-30-9

4-methyl-5-nitropyridine-2-carbonitrile

Description:

4-Methyl-5-nitropyridine-2-carbonitrile is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 4-position with a methyl group and at the 5-position with a nitro group, along with a cyano group at the 2-position. This compound typically exhibits a pale yellow to light brown crystalline appearance. It is known for its potential applications in pharmaceuticals and agrochemicals due to the presence of the nitro and cyano functional groups, which can participate in various chemical reactions. The compound is likely to be soluble in polar organic solvents, and its reactivity can be influenced by the electron-withdrawing nature of the nitro group, which can enhance electrophilic substitution reactions. Additionally, the presence of the cyano group may contribute to its ability to form coordination complexes with metals. Safety data should be consulted, as nitro compounds can be sensitive and potentially hazardous. Overall, 4-methyl-5-nitropyridine-2-carbonitrile is a versatile compound with significant synthetic utility in organic chemistry.

Formula: C₇H₅N₃O₂

InChI: InChI=1/C7H5N3O2/c1-5-2-6(3-8)9-4-7(5)10(11)12/h2,4H,1H3

SMILES: Cc1cc(C#N)ncc1N(=O)=O

Synonyms:

• 2-Cyano-4-methyl-5-nitropyridine
• 2-Pyridinecarbonitrile, 4-Methyl-5-Nitro-

2-Cyano-4-methyl-5-nitropyridine

CAS: 267875-30-9

Formula: C₇H₅N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 163.1335

Ref: IN-DA006TY1

4-Methyl-5-nitropicolinonitrile

CAS: 267875-30-9

4-Methyl-5-nitropicolinonitrile

Purity: 99%

Molecular weight: 163.13g/mol

Ref: 54-OR302219

2-Cyano-4-methyl-5-nitropyridine

CAS: 267875-30-9

Formula: C₇H₅N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 163.136

Ref: 10-F077598