CAS 267875-45-6

5,6-Diamino-3-pyridinecarboxylic acid

Description:

5,6-Diamino-3-pyridinecarboxylic acid, also known as DAPC, is an organic compound characterized by its pyridine ring structure with two amino groups and a carboxylic acid functional group. This compound is a derivative of pyridine, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the amino groups at the 5 and 6 positions enhances its potential for forming hydrogen bonds, making it a candidate for various biochemical applications. The carboxylic acid group contributes to its acidity and reactivity, allowing it to participate in various chemical reactions, including esterification and amidation. DAPC is often studied for its role in biological systems and its potential applications in pharmaceuticals, particularly in the development of compounds that can interact with biological targets. Its solubility in water and polar solvents is influenced by the functional groups present, making it suitable for various laboratory and industrial applications. Overall, 5,6-Diamino-3-pyridinecarboxylic acid is a versatile compound with significant implications in both chemistry and biochemistry.

Formula: C₆H₇N₃O₂

InChI: InChI=1S/C6H7N3O2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,7H2,(H2,8,9)(H,10,11)

InChI key: InChIKey=AMUTYVGRCVFCCD-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(N)C(N)=NC1

Synonyms:

• 3-Pyridinecarboxylic acid, 5,6-diamino-
• 5,6-Diamino-3-pyridinecarboxylic acid
• 5,6-Diaminopyridine-3-Carboxylic Acid

3-Pyridinecarboxylicacid,5,6-diamino-(9CI)

CAS: 267875-45-6

Formula: C₆H₇N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.1387

Ref: IN-DA00C4DZ

5,6-Diaminonicotinic acid

CAS: 267875-45-6

5,6-Diaminonicotinic acid

Purity: 97%

Molecular weight: 153.14g/mol

Ref: 54-OR85144

5,6-Diaminonicotinic acid

CAS: 267875-45-6

Formula: C₆H₇N₃O₂

Purity: 97%

Molecular weight: 153.141

Ref: 10-F321784

5,6-Diaminonicotinic acid

CAS: 267875-45-6

5,6-Diaminonicotinic acid is a fatty acid that belongs to the group of fatty acids and alcohol extract. It is found in the root of Radix Angelicae Dahuricae. 5,6-Diaminonicotinic acid has been synthesized from an organic solvent and radix angelicae dahuricae. This compound has viscosity properties at room temperature, which are synergistic with silicon. Organic solvents are used to dissolve this molecule for manufacturing purposes.

Formula: C₆H₇N₃O₂

Purity: Min. 95%

Molecular weight: 153.14 g/mol

Ref: 3D-SKA87545