CymitQuimica logo

CAS 267875-65-0

:

2,2-difluoro-2-pyridin-2-ylethanol

Description:
2,2-Difluoro-2-pyridin-2-ylethanol is an organic compound characterized by the presence of a pyridine ring and two fluorine atoms attached to a carbon atom adjacent to a hydroxyl group. This compound features a hydroxyl (-OH) functional group, which contributes to its potential as a solvent or reagent in various chemical reactions. The difluoromethyl group enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The presence of the pyridine moiety suggests potential applications in pharmaceuticals, as pyridine derivatives are often found in biologically active compounds. Additionally, the fluorine atoms can impart unique electronic properties, affecting the compound's polarity and solubility. The compound's structure may also influence its stability and interaction with other molecules, making it a subject of study in both synthetic and applied chemistry. Overall, 2,2-difluoro-2-pyridin-2-ylethanol is a versatile compound with potential applications in various fields, including drug development and materials science.
Formula:C7H7F2NO
InChI:InChI=1/C7H7F2NO/c8-7(9,5-11)6-3-1-2-4-10-6/h1-4,11H,5H2
InChI key:RTZZBUQTHNQTSR-UHFFFAOYSA-N
SMILES:c1ccnc(c1)C(CO)(F)F
Synonyms:
  • 2,2-Difluor-2-(pyridin-2-yl)ethanol
  • 2,2-Difluoro-2-(pyridin-2-yl)ethanol
  • 2-Pyridineethanol, Beta,Beta-Difluoro-
  • 2,2-Difluoro-2-(Pyridin-2-Yl)Ethan-1-Ol
Found 4 products.