CAS 267876-36-8

1H-Pyrrolo[2,3-b]pyridine-5-methanamine, hydrochloride (1:2)

Description:

1H-Pyrrolo[2,3-b]pyridine-5-methanamine, hydrochloride (1:2), with the CAS number 267876-36-8, is a chemical compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine ring fused together. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. It is often used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. The presence of the amine functional group allows for various chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, its hydrochloride form can influence its pharmacokinetic properties, such as absorption and bioavailability. As with many nitrogen-containing heterocycles, it may exhibit interesting biological activities, including potential effects on neurotransmitter systems, making it a subject of interest in medicinal chemistry. Proper handling and storage conditions should be observed due to its chemical nature and potential reactivity.

Formula: C₈H₉N₃·2ClH

InChI: InChI=1S/C8H9N3.2ClH/c9-4-6-3-7-1-2-10-8(7)11-5-6;;/h1-3,5H,4,9H2,(H,10,11);2*1H

InChI key: InChIKey=LRWFVHSPMFPOBJ-UHFFFAOYSA-N

SMILES: C(N)C=1C=C2C(=NC1)NC=C2.Cl

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-5-methanamine, dihydrochloride
• 1H-Pyrrolo[2,3-b]pyridine-5-methanamine, hydrochloride (1:2)

(1H-PYRROLO[2,3-B]PYRIDIN-5-YL)METHANAMINE HCL

CAS: 267876-36-8

Formula: C₈H₁₀ClN₃

Purity: 97%

Molecular weight: 183.64

Ref: 10-F467339