CAS 267880-81-9

3-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-propanenitrile

Description:

3-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-propanenitrile, with the CAS number 267880-81-9, is a chemical compound characterized by its unique structure that includes a propanenitrile moiety and a phenyl group substituted with two trifluoromethyl groups. This compound typically exhibits properties associated with both nitriles and aromatic compounds, such as high stability and potential reactivity due to the presence of the nitrile functional group. The trifluoromethyl groups contribute to its lipophilicity and can influence its electronic properties, making it a candidate for various applications in pharmaceuticals and agrochemicals. The presence of multiple electronegative fluorine atoms can enhance the compound's biological activity and alter its interaction with biological targets. Additionally, the compound may exhibit distinct physical properties, such as a specific melting point and solubility characteristics, which are important for its practical applications. Overall, this compound's unique structural features make it of interest in synthetic chemistry and material science.

Formula: C₁₁H₅F₆NO

InChI: InChI=1/C11H5F6NO/c12-10(13,14)7-3-6(9(19)1-2-18)4-8(5-7)11(15,16)17/h3-5H,1H2

SMILES: C(C#N)C(=O)c1cc(cc(c1)C(F)(F)F)C(F)(F)F

Synonyms:

• 3-[3,5-Bis(Trifluoromethyl)Phenyl]-3-Oxopropanenitrile
• Benzenepropanenitrile, Β-Oxo-3,5-Bis(Trifluoromethyl)-

3-(3,5-Bis(trifluoromethyl)phenyl)-3-oxopropanenitrile

CAS: 267880-81-9

Formula: C₁₁H₅F₆NO

Purity: 98%

Molecular weight: 281.1539

Ref: IN-DA00BHEA

3,5-Bis(trifluoromethyl)benzoylacetonitrile

CAS: 267880-81-9

3,5-Bis(trifluoromethyl)benzoylacetonitrile

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 281.15g/mol

Ref: 54-PC9068

3,5-bis(trifluoromethyl)benzoylacetonitrile

CAS: 267880-81-9

Formula: C₁₁H₅F₆NO

Purity: 98%

Molecular weight: 281.157

Ref: 10-F206986