CAS 2679-14-3
:N-Methyl-β-alanine
Description:
N-Methyl-β-alanine, with the CAS number 2679-14-3, is an amino acid derivative characterized by the presence of a methyl group attached to the nitrogen atom of the β-alanine structure. This compound is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. N-Methyl-β-alanine exhibits properties typical of amino acids, such as the ability to form zwitterions, which are molecules that have both positive and negative charges. It is soluble in water due to its polar nature, and its structure allows it to participate in various biochemical reactions. This compound is of interest in research related to neurochemistry and metabolic pathways, as it may play a role in the synthesis of neurotransmitters or other biologically relevant molecules. Additionally, N-Methyl-β-alanine can be utilized in the study of amino acid metabolism and may have implications in understanding certain neurological conditions. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature.
Formula:C4H9NO2
InChI:InChI=1S/C4H9NO2/c1-5-3-2-4(6)7/h5H,2-3H2,1H3,(H,6,7)
InChI key:InChIKey=VDIPNVCWMXZNFY-UHFFFAOYSA-N
SMILES:C(C(O)=O)CNC
Synonyms:- 3-(Methylamino)propanoic acid
- 3-(Methylamino)propionic acid
- N-Methyl-β-alanine
- N-Methyl-β-aminopropionic acid
- beta-Alanine, N-methyl-
- β-Alanine, N-methyl-
- N-Methyl-beta-alanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-(Methylamino)propanoic acid
CAS:Formula:C4H9NO2Purity:95%Color and Shape:SolidMolecular weight:103.1198Ref: IN-DA003I8Q
1g55.00€5g132.00€10g189.00€1kgTo inquire25g535.00€500gTo inquire100mg24.00€250mg25.00€3-(Methylamino)propanoic acid
CAS:3-(Methylamino)propanoic acidPurity:98%Color and Shape:SolidMolecular weight:103.12g/molN-Methyl-β-alanine
CAS:Formula:C4H9NO2Purity:>95.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:103.12N-Methyl-β-alanine
CAS:N-Methyl-β-alanine is a synthetic amino acid that can be used as an additive to animal feed. It has been shown to synergistically increase the potency of dermorphin, a peptide that is derived from the skin of frogs. N-Methyl-β-alanine has also been found to have a useful application in industrial chemistry because it can be used to produce fluorophores, which are substances that emit visible light and are often used in paints and plastics. This substance is also a powerful antinociceptive agent, meaning it reduces pain. It is also active against amines, which are organic compounds containing nitrogen.Formula:C4H9NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:103.12 g/mol






