CAS 2679-89-2
:Ether-d10
Description:
Ether-d10, also known as deuterated ether, is a chemical compound characterized by the presence of deuterium, a stable isotope of hydrogen, which replaces the regular hydrogen atoms in the ether molecule. This substitution results in a compound that is often used in various scientific applications, particularly in nuclear magnetic resonance (NMR) spectroscopy, where its unique isotopic labeling allows for enhanced resolution and sensitivity in the analysis of organic compounds. Ether-d10 is typically a colorless, volatile liquid with properties similar to those of standard ethers, such as low viscosity and a relatively low boiling point. Its deuterated nature makes it useful in studies involving reaction mechanisms, molecular dynamics, and the behavior of solvents in chemical reactions. Additionally, due to its isotopic labeling, Ether-d10 can help in tracing pathways in metabolic studies and in the development of pharmaceuticals. Safety precautions should be observed when handling this compound, as with any chemical substance, to minimize exposure and ensure proper laboratory practices.
Formula:C4D10O
InChI:InChI=1/C4H10O/c1-3-5-4-2/h3-4H2,1-2H3/i1D3,2D3,3D2,4D2
InChI key:InChIKey=RTZKZFJDLAIYFH-MWUKXHIBSA-N
SMILES:C(C(OC(C([2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]
Synonyms:- (Ethyl ether)-d<sub>10</sub>
- 1,1'-oxydi(~2~H_5_)ethane
- 2,2′-Oxybis[ethane-1,1,1,2,2-d<sub>5</sub>]
- Diethyl ether-d10
- Diethyl ether-d<sub>10</sub>
- Diethyl-d<sub>10</sub> ether
- Ethane-1,1,1,2,2-d<sub>5</sub>, 2,2′-oxybis-
- Ethane-d<sub>5</sub>, 2,2′-oxybis-
- Ethyl ether-d10
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Diethyl ether-d{10}, 99%(Isotopic)
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C4D10OPurity:99%Color and Shape:Clear colorless, LiquidMolecular weight:84.19Diethylether-D10 1ml ampule
CAS:Diethylether-D10 1ml ampule
Color and Shape:Colourless LiquidMolecular weight:84.18g/molDiethylether-D10 5ml ampule
CAS:Diethylether-D10 5ml ampule
Color and Shape:Colourless LiquidMolecular weight:84.18g/mol

