CAS 26798-52-7

(H-Gly-Cys-OH)2 (Disulfide bond)

Description:

The chemical substance with the name (H-Gly-Cys-OH)2, commonly referred to as a disulfide bond between two glycine-cysteine residues, is a dipeptide derivative that features a cysteine moiety capable of forming disulfide linkages. This compound is characterized by its ability to participate in redox reactions due to the thiol (-SH) groups present in cysteine, which can oxidize to form disulfide bonds (–S–S–) under appropriate conditions. The presence of glycine, the simplest amino acid, contributes to the overall stability and solubility of the molecule. This substance is often studied in the context of protein structure and function, as disulfide bonds play a crucial role in stabilizing the three-dimensional conformation of proteins. Additionally, it may exhibit biological activity, influencing various biochemical pathways. Its CAS number, 26798-52-7, allows for precise identification in chemical databases, facilitating research and application in fields such as biochemistry, pharmacology, and materials science.

Formula: C₁₀H₁₈N₄O₆S₂

InChI: InChI=1/C10H18N4O6S2/c11-1-7(15)13-5(9(17)18)3-21-22-4-6(10(19)20)14-8(16)2-12/h5-6H,1-4,11-12H2,(H,13,15)(H,14,16)(H,17,18)(H,19,20)

SMILES: C(C(=NC(CSSCC(C(=O)O)N=C(CN)O)C(=O)O)O)N

Synonyms:

• 3,3'-Disulfanediylbis{2-[(Aminoacetyl)Amino]Propanoic Acid} (Non-Preferred Name)
• (H-Gly-Cys-Oh)2

(H-Gly-Cys-OH)2 (Disulfide bond)

CAS: 26798-52-7

Please enquire for more information about (H-Gly-Cys-OH)2 (Disulfide bond) including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₀H₁₈N₄O₆S₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 354.41 g/mol

Ref: 3D-FG108022