CAS 26825-83-2
:1-Iodoheptadecane
Description:
1-Iodoheptadecane is an organic compound classified as a halogenated alkane, specifically an iodinated long-chain alkane. It consists of a straight-chain structure with 17 carbon atoms (heptadecane) and a single iodine atom attached to one of the terminal carbon atoms. This compound is typically a colorless to pale yellow liquid at room temperature, exhibiting low solubility in water due to its hydrophobic nature, but it is soluble in organic solvents such as ethanol and ether. The presence of the iodine atom imparts unique reactivity, making it useful in various chemical synthesis processes, including nucleophilic substitution reactions. Additionally, 1-iodoheptadecane can serve as a surfactant or a precursor in the synthesis of other organic compounds. Its physical properties, such as boiling point and melting point, are influenced by the length of the carbon chain and the presence of the iodine atom, which can affect intermolecular forces. Safety precautions should be taken when handling this compound, as iodine can be hazardous in certain concentrations.
Formula:C17H35I
InChI:InChI=1S/C17H35I/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18/h2-17H2,1H3
InChI key:InChIKey=SWGRLCBZNPROCQ-UHFFFAOYSA-N
SMILES:C(CCCCCCCCI)CCCCCCCC
Synonyms:- 1-Iodoheptadecane
- Heptadecyl iodide
- Heptadecane, 1-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
