CAS 26825-92-3
:8-Bromooctanoic acid methyl ester
Description:
8-Bromooctanoic acid methyl ester is an organic compound characterized by its brominated octanoic acid structure, where a bromine atom is attached to the eighth carbon of the octanoic acid chain. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic octanoic acid backbone. The presence of the bromine atom introduces unique reactivity, making it useful in various chemical syntheses and applications, particularly in the field of organic chemistry and materials science. It may also exhibit biological activity, which can be of interest in pharmaceutical research. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation or toxicity. Proper storage conditions are essential to maintain its stability and prevent degradation.
Formula:C9H17BrO2
InChI:InChI=1/C9H17BrO2/c1-12-9(11)7-5-3-2-4-6-8-10/h2-8H2,1H3
SMILES:COC(=O)CCCCCCCBr
Synonyms:- Methyl 8-Bromooctanoate
- Octanoic Acid, 8-Bromo-, Methyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Octanoic acid,8-bromo-, methyl ester
CAS:Formula:C9H17BrO2Purity:98%Color and Shape:LiquidMolecular weight:237.1341Octanoic acid, 8-bromo-, methyl ester
CAS:Octanoic acid, 8-bromo-, methyl ester is a histone deacetylase (HDAC) inhibitor that belongs to the class of fatty esters. It has been shown to inhibit cancer cell proliferation and induce cell apoptosis in MDA-MB-231 cells by inhibiting HDAC activity. This drug also has inhibitory activities against cyclin D1 and Bcl-2 expression, which are two proteins that regulate the cell cycle. Octanoic acid, 8-bromo-, methyl ester inhibits HDAC activity by forming an amide bond with the catalytic subunit of the enzyme. This inhibition can be reversed by an aziridine in vitro. Octanoic acid, 8-bromo-, methyl ester also possesses a carbonyl group and functional groups that make it a powerful inhibitor of HDACs.
Formula:C9H17BrO2Purity:Min. 95%Molecular weight:237.13 g/mol



