CAS 26825-95-6

Dodecanoic acid, 12-bromo-, methyl ester

Description:

Dodecanoic acid, 12-bromo-, methyl ester, also known as methyl 12-bromododecanoate, is an organic compound characterized by its ester functional group derived from dodecanoic acid (a fatty acid) and bromine substitution at the 12th carbon position. This compound typically appears as a colorless to pale yellow liquid with a characteristic fatty odor. It is soluble in organic solvents but has limited solubility in water due to its long hydrophobic carbon chain. The presence of the bromine atom introduces unique reactivity, making it useful in various chemical synthesis applications, particularly in organic chemistry for the introduction of bromine into other compounds. Its molecular structure contributes to its physical properties, such as boiling and melting points, which are influenced by the length of the carbon chain and the presence of the bromine atom. Safety precautions should be taken when handling this compound, as it may pose health risks, including skin and respiratory irritation. Proper storage and disposal methods are essential to minimize environmental impact.

Formula: C₁₃H₂₅BrO₂

InChI: InChI=1S/C13H25BrO2/c1-16-13(15)11-9-7-5-3-2-4-6-8-10-12-14/h2-12H2,1H3

InChI key: InChIKey=QNXOHINFQALBQN-UHFFFAOYSA-N

SMILES: C(CCC(OC)=O)CCCCCCCCBr

Synonyms:

• 12-Bromododecanoic acid methyl ester
• Methyl 12-bromododecanoate
• Dodecanoic acid, 12-bromo-, methyl ester

Dodecanoic acid, 12-bromo-, methyl ester

CAS: 26825-95-6

Formula: C₁₃H₂₅BrO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 293.2404

Ref: IN-DA00I52K

Methyl 12-Bromododecanoate

CAS: 26825-95-6

Methyl 12-Bromododecanoate

Formula: C₁₃H₂₅BrO₂

Purity: ≥95%

Color and Shape: clear. light yellow liquid

Molecular weight: 293.24g/mol

Ref: 54-OR471516

Methyl 12-bromododecanoate

CAS: 26825-95-6

Formula: C₁₃H₂₅BrO₂

Purity: 97%

Molecular weight: 293.245

Ref: 10-F544912