CymitQuimica logo

CAS 26825-95-6

:

Dodecanoic acid, 12-bromo-, methyl ester

Description:
Dodecanoic acid, 12-bromo-, methyl ester, also known as methyl 12-bromododecanoate, is an organic compound characterized by its ester functional group derived from dodecanoic acid (a fatty acid) and bromine substitution at the 12th carbon position. This compound typically appears as a colorless to pale yellow liquid with a characteristic fatty odor. It is soluble in organic solvents but has limited solubility in water due to its long hydrophobic carbon chain. The presence of the bromine atom introduces unique reactivity, making it useful in various chemical synthesis applications, particularly in organic chemistry for the introduction of bromine into other compounds. Its molecular structure contributes to its physical properties, such as boiling and melting points, which are influenced by the length of the carbon chain and the presence of the bromine atom. Safety precautions should be taken when handling this compound, as it may pose health risks, including skin and respiratory irritation. Proper storage and disposal methods are essential to minimize environmental impact.
Formula:C13H25BrO2
InChI:InChI=1S/C13H25BrO2/c1-16-13(15)11-9-7-5-3-2-4-6-8-10-12-14/h2-12H2,1H3
InChI key:InChIKey=QNXOHINFQALBQN-UHFFFAOYSA-N
SMILES:C(CCC(OC)=O)CCCCCCCCBr
Synonyms:
  • 12-Bromododecanoic acid methyl ester
  • Methyl 12-bromododecanoate
  • Dodecanoic acid, 12-bromo-, methyl ester
Found 4 products.