CAS 2683-82-1: Octaethylporphyrin
Description:Octaethylporphyrin (OEP) is a synthetic porphyrin compound characterized by its unique structure, which consists of a porphyrin core with eight ethyl groups attached to the nitrogen atoms of the pyrrole units. This modification enhances its solubility in organic solvents and alters its electronic properties compared to natural porphyrins. OEP exhibits strong absorption in the visible region of the electromagnetic spectrum, making it useful in various applications, including photodynamic therapy, solar energy conversion, and as a dye in organic electronics. The compound is typically characterized by its deep red color and exhibits distinct fluorescence properties. Additionally, OEP can form complexes with metal ions, which can further modify its chemical behavior and reactivity. Its stability and versatility make it a valuable compound in both research and industrial applications, particularly in the fields of materials science and biochemistry. Safety precautions should be observed when handling OEP, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C36H46N4
InChI:InChI=1S/C36H46N4/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30/h17-20,37,40H,9-16H2,1-8H3/b29-17-,30-18-,31-17?,32-18?,33-19-,34-20-,35-19?,36-20?
InChI key:InChIKey=HCIIFBHDBOCSAF-UKMKPXHGSA-N
SMILES:N1=C2C=C3NC(=CC4=NC(=CC=5NC(C=C1C(=C2CC)CC)=C(C5CC)CC)C(=C4CC)CC)C(=C3CC)CC
- Synonyms:
- 1,2,3,4,5,6,7,8-Octaethylporphyrin
- 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphin
- 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine
- 2,3,7,8,12,13,17,18-Octaetioporphyrin
- 21H,23H-porphine, 2,3,7,8,12,13,17,18-octaethyl-
- Octaethylporphine
- Octaethylporphyrin
- Porphine, 1,2,3,4,5,6,7,8-octaethyl-
- Porphine, 2,3,7,8,12,13,17,18-octaethyl-
- See more synonyms
- 2,3,7,8,12,13,17,18-Octaethylporphyrin
