CAS 26830-94-4
:2,6-dichloropyrimidine-4-carbonyl chloride
Description:
2,6-Dichloropyrimidine-4-carbonyl chloride is a chemical compound characterized by its pyrimidine ring structure, which features two chlorine atoms at the 2 and 6 positions and a carbonyl chloride functional group at the 4 position. This compound is typically a white to light yellow solid and is known for its reactivity due to the presence of the carbonyl chloride group, which can undergo nucleophilic substitution reactions. It is often used as an intermediate in the synthesis of pharmaceuticals and agrochemicals, owing to its ability to participate in various chemical transformations. The presence of chlorine atoms enhances its electrophilic character, making it a valuable building block in organic synthesis. Additionally, it is important to handle this compound with care, as carbonyl chlorides can be corrosive and may release toxic gases upon hydrolysis. Proper safety measures, including the use of personal protective equipment and working in a well-ventilated area, are essential when working with this substance.
Formula:C5HCl3N2O
InChI:InChI=1/C5HCl3N2O/c6-3-1-2(4(7)11)9-5(8)10-3/h1H
SMILES:c1c(C(=O)Cl)nc(Cl)nc1Cl
Synonyms:- 4-Pyrimidinecarbonyl Chloride, 2,6-Dichloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,6-Dichloropyrimidine-4-carbonyl chloride
CAS:2,6-Dichloropyrimidine-4-carbonyl chloridePurity:95%Molecular weight:211.43g/mol2,6-Dichloropyrimidine-4-carbonyl chloride
CAS:Formula:C5HCl3N2OPurity:95.0%Color and Shape:LiquidMolecular weight:211.432,6-Dichloropyrimidine-4-carbonyl chloride
CAS:Controlled ProductFormula:C5HCl3N2OColor and Shape:NeatMolecular weight:211.432,6-Dichloropyrimidine-4-carbonyl chloride
CAS:2,6-Dichloropyrimidine-4-carbonyl chloride is a chemical compound that is used as an intermediate in the synthesis of different drugs. It is also used as an intermediate for the synthesis of 2,6-dichloropyrimidines. This compound is a colorless liquid with a strong odor of chloroform.Formula:C5HCl3N2OPurity:Min. 95%Molecular weight:211.43 g/mol




