CAS 26831-44-7

N-ethyl-2-(tricyclo[3.3.1.1~3,7~]dec-1-yl)ethanamine hydrochloride (1:1)

Description:

N-ethyl-2-(tricyclo[3.3.1.1^3,7]dec-1-yl)ethanamine hydrochloride is a chemical compound characterized by its complex bicyclic structure, which includes a tricyclic decane framework. This compound features an ethyl group and an amine functional group, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the amine group suggests potential interactions with biological systems, possibly influencing neurotransmitter pathways. Its unique structure may also impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's CAS number, 26831-44-7, allows for precise identification and retrieval of information in chemical databases. Overall, N-ethyl-2-(tricyclo[3.3.1.1^3,7]dec-1-yl)ethanamine hydrochloride represents a fascinating subject for further research, particularly in the fields of organic synthesis and drug development.

Formula: C₁₄H₂₆ClN

InChI: InChI=1/C14H25N.ClH/c1-2-15-4-3-14-8-11-5-12(9-14)7-13(6-11)10-14;/h11-13,15H,2-10H2,1H3;1H

SMILES: CCNCCC12CC3CC(CC(C3)C2)C1.Cl

[2-(1-adamantyl)ethyl]ethylamine hydrochloride

CAS: 26831-44-7

Purity: 95.0%

Molecular weight: 243.82000732421875

Ref: 10-F390740