CymitQuimica logo

CAS 26832-08-6

:

1H-Imidazole-5-carboxamide

Description:
1H-Imidazole-5-carboxamide, with the CAS number 26832-08-6, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxamide functional group, which contributes to its polar nature and potential for hydrogen bonding. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activity and role as a building block in the synthesis of pharmaceuticals. Its properties may include moderate stability under standard conditions, but it can be sensitive to extreme pH levels or high temperatures. Additionally, 1H-Imidazole-5-carboxamide may exhibit tautomerism, allowing for different structural forms that can influence its reactivity and interactions with other molecules. Overall, its unique structure and functional groups make it a valuable compound for research and application in chemical synthesis and drug development.
Formula:C4H5N3O
InChI:InChI=1S/C4H5N3O/c5-4(8)3-1-6-2-7-3/h1-2H,(H2,5,8)(H,6,7)
InChI key:InChIKey=ZBNZAJFNDPPMDT-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CN=CN1
Synonyms:
  • Imidazole-4-carboxamide
  • 4-Carbamoylimidazole
  • 1H-Imidazole-5-carboxamide
  • 1H-Imidazole-4-carboxamide
  • IEM 1369
Found 5 products.