CAS 26832-96-2
:(4-Fluorophenylamino)methylenemalonic acid diethyl ester
Description:
(4-Fluorophenylamino)methylenemalonic acid diethyl ester, with the CAS number 26832-96-2, is an organic compound characterized by its unique structure that includes a fluorinated phenyl group and a methylenemalonic acid moiety. This compound typically exhibits properties associated with both amines and esters, including potential solubility in organic solvents and moderate reactivity due to the presence of functional groups. The fluorine atom can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its biological activity. As a diethyl ester, it may participate in various chemical reactions, such as hydrolysis or transesterification, under appropriate conditions. The presence of the methylene bridge contributes to its structural stability while allowing for potential interactions in biological systems. Overall, this compound may be of interest in medicinal chemistry and materials science due to its unique functional groups and potential applications in drug development or as a synthetic intermediate.
Formula:C14H16FNO4
InChI:InChI=1/C14H16FNO4/c1-3-19-13(17)12(14(18)20-4-2)9-16-11-7-5-10(15)6-8-11/h5-9,16H,3-4H2,1-2H3
SMILES:CCOC(=O)C(=CNc1ccc(cc1)F)C(=O)OCC
Synonyms:- Diethyl {[(4-Fluorophenyl)Amino]Methylidene}Propanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Diethyl 2-((4-fluorophenylamino)methylene)malonate
CAS:<p>Diethyl 2-((4-fluorophenylamino)methylene)malonate</p>Molecular weight:281.28g/mol
