CAS 26839-52-1

(-)-Isolongifolenone

Description:

(-)-Isolongifolenone is a naturally occurring sesquiterpene ketone characterized by its unique molecular structure and properties. It is derived from various plant sources, particularly those in the Asteraceae family. This compound typically exhibits a pleasant, woody aroma, making it valuable in the fragrance and flavor industries. Chemically, it is known for its chiral nature, with the "(-)" designation indicating its specific optical activity. The compound has a relatively low molecular weight and is soluble in organic solvents, which facilitates its use in various applications. Additionally, (-)-Isolongifolenone has been studied for its potential biological activities, including antimicrobial and anti-inflammatory properties, although further research is needed to fully understand its mechanisms and therapeutic potential. Its stability under standard conditions and compatibility with other compounds make it a versatile ingredient in formulations. Overall, (-)-Isolongifolenone is an interesting compound with applications in both natural product chemistry and industrial uses.

Formula: C₁₅H₂₂O

InChI: InChI=1S/C15H22O/c1-13(2)9-11(16)7-12-14(3,4)10-5-6-15(12,13)8-10/h7,10H,5-6,8-9H2,1-4H3/t10-,15-/m0/s1

InChI key: InChIKey=LGSKOQUJWNADCQ-BONVTDFDSA-N

SMILES: CC1(C)[C@]23C(C(C)(C)[C@](C2)(CC3)[H])=CC(=O)C1

Synonyms:

• (2S,4aR)-1,2,3,4,5,6-Hexahydro-1,1,5,5-tetramethyl-7H-2,4a-methanonaphthalen-7-one
• 7H-2,4a-Methanonaphthalen-7-one, 1,2,3,4,5,6-hexahydro-1,1,5,5-tetramethyl-, (2S,4aR)-(-)-
• 9-Oxoisolongifolene
• 7H-2,4a-Methanonaphthalen-7-one, 1,2,3,4,5,6-hexahydro-1,1,5,5-tetramethyl-, (2S,4aR)-
• 7H-2,4a-Methanonaphthalen-7-one, 1,2,3,4,5,6-hexahydro-1,1,5,5-tetramethyl-, (2S)-

(-)-Isolongifolen-9-one

CAS: 26839-52-1

(-)-Isolongifolen-9-one is a sesquiterpenoid compound, which is a type of naturally occurring terpenoid. It is primarily derived from plants and essential oils, particularly those in the Pinaceae family. The compound's molecular structure contributes to its characteristic aromatic properties, making it a subject of interest in both chemical and biological research.

Formula: C₁₅H₂₂O

Purity: Min. 95%

Molecular weight: 218.33 g/mol

Ref: 3D-FI35478