CAS 26843-47-0

Bicyclo[2.2.2]octane-2,3-dicarboxylic Anhydride

Description:

Bicyclo[2.2.2]octane-2,3-dicarboxylic anhydride, with the CAS number 26843-47-0, is a bicyclic organic compound characterized by its unique structural framework, which consists of a bicyclo[2.2.2]octane core with two carboxylic acid groups that are converted into an anhydride form. This compound typically exhibits a high degree of stability due to its rigid bicyclic structure, which can influence its reactivity and interaction with other chemical species. The anhydride functional group is known for its ability to undergo hydrolysis, forming the corresponding dicarboxylic acid upon reaction with water. Additionally, this compound may serve as a useful intermediate in organic synthesis, particularly in the production of polymers and other complex molecules. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Overall, bicyclo[2.2.2]octane-2,3-dicarboxylic anhydride is a valuable compound in the field of organic chemistry and materials science.

Formula: C₂₀H₂₆O₇

InChI: InChI=1/C20H26O7/c21-17(22)13-9-1-5-11(6-2-9)15(13)19(25)27-20(26)16-12-7-3-10(4-8-12)14(16)18(23)24/h9-16H,1-8H2,(H,21,22)(H,23,24)

SMILES: C1CC2CCC1C(C2C(=O)OC(=O)C1C2CCC(CC2)C1C(=O)O)C(=O)O

4-oxatricyclo[5.2.2.0~2,6~]undecane-3,5-dione

CAS: 26843-47-0

4-oxatricyclo[5.2.2.0~2,6~]undecane-3,5-dione

Purity: ≥95%

Molecular weight: 180.20g/mol

Ref: 54-OR22916

4-Oxatricyclo[5.2.2.0,2,6]undecane-3,5-dione

CAS: 26843-47-0

Versatile small molecule scaffold

Formula: C₁₀H₁₂O₃

Purity: Min. 95%

Molecular weight: 180.2 g/mol

Ref: 3D-BBA84347