CAS 26850-24-8
:1,3-Bis(2-hydroxyethyl)-5,5-dimethyl-2,4-imidazolidinedione
Description:
1,3-Bis(2-hydroxyethyl)-5,5-dimethyl-2,4-imidazolidinedione, commonly known as a derivative of imidazolidinedione, is a chemical compound characterized by its unique structure that includes two hydroxyethyl groups and a dimethyl substitution on the imidazolidinedione ring. This compound typically exhibits properties such as solubility in polar solvents due to the presence of hydroxyl groups, which enhance its ability to interact with water and other polar substances. It is often utilized in various applications, including as a stabilizer or additive in polymer formulations and in the synthesis of other chemical compounds. The presence of the imidazolidinedione moiety suggests potential biological activity, making it of interest in pharmaceutical research. Additionally, its molecular structure allows for potential interactions with biological systems, which may lead to applications in drug development or as a biochemical reagent. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H16N2O4
InChI:InChI=1/C9H16N2O4/c1-9(2)7(14)10(3-5-12)8(15)11(9)4-6-13/h12-13H,3-6H2,1-2H3
InChI key:InChIKey=ATIAIEWDRRJGSL-UHFFFAOYSA-N
SMILES:C(CO)N1C(=O)N(CCO)C(=O)C1(C)C
Synonyms:- 1,3-Bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione
- 1,3-Bis(hydroxyethyl)-5,5-dimethylhydantoin
- 1,3-Bis(β-hydroxyethyl)-5,5-dimethylhydantoin
- 1,3-Di(2-hydroxyethyl)-5,5-dimethylhydantoin
- 1,3-bis(2-hydroxyethyl)-5,5-dimethyl-2,4-Imidazolidinedione
- 2,4-Imidazolidinedione, 1,3-bis(2-hydroxyethyl)-5,5-dimethyl-
- Dantocol DHE
- Hydantoin, 1,3-bis(2-hydroxyethyl)-5,5-dimethyl-
- N,N′-Bis(2-hydroxyethyl)dimethylhydantoin
- 1,3-Bis(2-hydroxyethyl)-5,5-dimethylhydantoin
- 1,3-Bis(2-hydroxyethyl)-5,5-dimethylimidazolidin-2,4-dione
- 1,3-Bis(2-Hydroxyethyl)-5,5-dimethylhydantoine
- 1,3-Bis(2-hydroxyethyl)-4,4-dimethylimidazolidine-2,5-dione
- 1,3-bis(2-hydroxyethyl)-5,5-dimethyl-4-imidazolidinedione
- Di(2-Hydroxyethyl)-5, 5-Dimethyl Hydantoin
- Dantocol(R) DHE
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4-Imidazolidinedione, 1,3-bis(2-hydroxyethyl)-5,5-dimethyl-
CAS:Formula:C9H16N2O4Purity:98%Color and Shape:SolidMolecular weight:216.23431,3-Bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione
CAS:1,3-Bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dionePurity:98%1,3-Di-(2-hydroxyethyl)-5,5-dimethylhydantoin
CAS:Formula:C9H16N2O4Color and Shape:NeatMolecular weight:216.2341,3-Bis(2-hydroxyethyl)-5,5-dimethylhydantoin
CAS:1,3-Bis(2-hydroxyethyl)-5,5-dimethylhydantoin is a biodegradable detergent that can be used in personal care products. It was found to have a high viscosity and chemical stability. It has been used as an antimicrobial agent in pharmaceutical preparations. The copper complex of 1,3-bis(2-hydroxyethyl)-5,5-dimethylhydantoin has been shown to have antimicrobial activity against a wide range of microorganisms. The nitrogen atoms in this compound are coordinated by two metal ions (Cu or Ag), forming a chelate complex with them. This average particle diameter is about 5 micrometres for the particles of 1,3-bis(2-hydroxyethyl)-5,5-dimethylhydantoin
Formula:C9H16N2O4Purity:Area-% Min. 95 Area-%Color and Shape:Slightly Yellow Clear LiquidMolecular weight:216.23 g/mol1,3-BIS(2-HYDROXYETHYL)-5,5-DIMETHYLIMIDAZOLIDINE-2,4-DIONE
CAS:Purity:98%Molecular weight:216.2369995




