CAS 268541-26-0
:Triptohypol F
Description:
Triptohypol F, identified by its CAS number 268541-26-0, is a chemical compound that belongs to a class of substances known for their potential pharmacological properties. While specific characteristics such as molecular structure, solubility, and reactivity may vary, compounds in this category often exhibit biological activity, which can include effects on neurotransmitter systems or other physiological pathways. The compound may be studied for its potential therapeutic applications, particularly in areas related to mental health or neurological function. As with many chemical substances, safety and handling precautions are essential, and its use would typically be governed by regulatory guidelines. Detailed information regarding its synthesis, mechanism of action, and specific applications would be found in specialized scientific literature or databases. Always consult reliable sources for the most accurate and up-to-date information regarding any chemical substance.
Formula:C31H52O2
InChI:InChI=1S/C31H52O2/c1-26(2)14-15-28(5)16-17-30(7)20(21(28)19-26)18-22(33-9)25-29(6)12-11-24(32)27(3,4)23(29)10-13-31(25,30)8/h18,21-25,32H,10-17,19H2,1-9H3/t21-,22+,23-,24-,25+,28+,29-,30+,31+/m0/s1
InChI key:InChIKey=VKGXBRHZFJRMOC-BCZIGNCTSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@@H](O)CC3)[H])([C@H](OC)C=C4[C@@]2(C)CC[C@]5(C)[C@]4(CC(C)(C)CC5)[H])[H]
Synonyms:- Olean-12-en-3-ol, 11-methoxy-, (3β,11α)-
- (3β,11α)-11-Methoxyolean-12-en-3-ol
- Triptohypol F
- 3β-Hydroxy-11α-methoxy-olean-12-ene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Triptohypol F
CAS:<p>Triptohypol F is a natural product for research related to life sciences. The catalog number is TN5184 and the CAS number is 268541-26-0.</p>Formula:C31H52O2Purity:98%Color and Shape:SolidMolecular weight:456.74Triptohypol F
CAS:Controlled Product<p>Triptohypol F is a natural compound, classified as a triterpenoid, which is derived from the root extracts of the medicinal plant *Tripterygium wilfordii*. This compound is known for its unique mode of action involving the modulation of various cellular pathways, particularly those associated with inflammation and immune response. Triptohypol F is thought to exert its effects through the inhibition of specific enzymes and signaling molecules, which play a crucial role in inflammatory processes.</p>Formula:C31H52O2Purity:Min. 95%Molecular weight:456.7 g/mol


