CymitQuimica logo

CAS 268550-48-7

:

tert-butyl 1-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate

Description:
Tert-butyl 1-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a diazabicyclic framework. This compound features a tert-butyl ester group, contributing to its solubility and stability in various organic solvents. The presence of the oxo group indicates a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions. The spiro structure imparts rigidity to the molecule, influencing its reactivity and interaction with biological systems. Additionally, the compound's carboxylate moiety can engage in hydrogen bonding and ionic interactions, making it potentially useful in medicinal chemistry and as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular environment and substituents. Overall, tert-butyl 1-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate represents a versatile compound with applications in various fields, including pharmaceuticals and materials science.
Formula:C13H22N2O3
InChI:InChI=1/C13H22N2O3/c1-12(2,3)18-11(17)15-8-5-13(6-9-15)4-7-14-10(13)16/h4-9H2,1-3H3,(H,14,16)
InChI key:ADPIEGXXCABJCH-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2(CCN=C2O)CC1
Synonyms:
  • tert-Butyl-1-oxo-2,8-diazaspiro[4.5]decan-8-carboxylat
  • Tert-Butyl 1-Oxo-2,8-Diazaspiro[4,5]Decane-8-Carboxylate
Found 4 products.