CAS 268564-10-9
:N-Fmoc-N',N'-dimethyl-L-arginine (asymmetrical)
Description:
N-Fmoc-N',N'-dimethyl-L-arginine (asymmetrical) is a synthetic amino acid derivative characterized by the presence of a fluorenylmethyloxycarbonyl (Fmoc) protecting group on the nitrogen atom of the arginine side chain. This compound features two dimethyl groups attached to the guanidinium nitrogen, which contributes to its asymmetrical nature. The Fmoc group serves as a protective moiety, facilitating the synthesis of peptides by preventing unwanted reactions during coupling processes. The molecule retains the basic properties of arginine, including its positive charge at physiological pH, which influences its solubility and interaction with biological systems. N-Fmoc-N',N'-dimethyl-L-arginine is often utilized in peptide synthesis and research applications, particularly in the development of bioactive peptides and in studies involving protein interactions. Its unique structural features make it a valuable tool in medicinal chemistry and biochemistry, allowing for the exploration of arginine's role in various biological processes.
Formula:C23H28N4O4
InChI:InChI=1/C23H28N4O4/c1-27(2)22(24)25-13-7-12-20(21(28)29)26-23(30)31-14-19-17-10-5-3-8-15(17)16-9-4-6-11-18(16)19/h3-6,8-11,19-20H,7,12-14H2,1-2H3,(H2,24,25)(H,26,30)(H,28,29)/t20-/m0/s1
SMILES:CN(C)C(=N)NCCC[C@@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:- N5-[(Dimethylamino)iminomethyl]-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-ornithine
- Fmoc-arg(me2, asymmetric)-OH HCL
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Fmoc-Arg(Me)₂-OH (asymmetrical)
CAS:Fmoc-ADMA hydrochloride saltFormula:C23H28N4O4Purity:98.8%Color and Shape:White PowderMolecular weight:424.5FMOC-ARG(ME2, ASYMMETRIC)-OH HCL
CAS:Formula:C23H28N4O4Purity:95%Color and Shape:SolidMolecular weight:424.4928Fmoc-Arg(Me)2-OH, asymmetrical
CAS:Fmoc-Arg(Me)2-OH is a high quality, versatile building block that can be used in the synthesis of complex compounds and fine chemicals. It is an intermediate that is useful as a reagent in organic chemistry and as a speciality chemical. Fmoc-Arg(Me)2-OH has been shown to react with other amino acids to form peptides and proteins, or it may be used as a building block for the synthesis of polymers. The compound has been shown to have many uses, including being a reaction component for the synthesis of pharmaceuticals and bioactive molecules.Formula:C23H28N4O4Purity:Min. 95%Color and Shape:PowderMolecular weight:424.49 g/mol



