CAS 26857-61-4
:tin(iv) 2,3-naphthalocyanine dichloride
Description:
Tin(IV) 2,3-naphthalocyanine dichloride, with the CAS number 26857-61-4, is a coordination compound characterized by its complex structure and vibrant color. It features a tin ion in the +4 oxidation state coordinated to a naphthalocyanine ligand, which is a polycyclic aromatic compound known for its stability and ability to form strong complexes with metal ions. This compound typically exhibits a deep blue or green color due to the electronic transitions within the naphthalocyanine framework. It is insoluble in water but may dissolve in organic solvents, making it useful in various applications, including dyes, pigments, and potential photonic materials. The dichloride aspect indicates the presence of two chloride ions, which can influence the compound's reactivity and solubility. Additionally, tin(IV) naphthalocyanines are of interest in fields such as photodynamic therapy and solar energy conversion due to their light-absorbing properties and stability under various conditions. Overall, this compound exemplifies the intersection of coordination chemistry and materials science.
Formula:C48H24Cl2N8Sn
InChI:InChI=1/C48H24N8.2ClH.Sn/c1-2-10-26-18-34-33(17-25(26)9-1)41-49-42(34)54-44-37-21-29-13-5-6-14-30(29)22-38(37)46(51-44)56-48-40-24-32-16-8-7-15-31(32)23-39(40)47(52-48)55-45-36-20-28-12-4-3-11-27(28)19-35(36)43(50-45)53-41;;;/h1-24H;2*1H;/q-2;;;+4/p-2/rC48H24Cl2N8Sn/c49-59(50)57-45-37-21-29-13-5-6-14-30(29)22-38(37)47(57)55-43-35-19-27-11-3-4-12-28(27)20-36(35)44(52-43)56-48-40-24-32-16-8-7-15-31(32)23-39(40)46(58(48)59)54-42-34-18-26-10-2-1-9-25(26)17-33(34)41(51-42)53-45/h1-24H/b53-41-,53-45u,54-42u,54-46u,55-43u,55-47u,56-44u,56-48u
SMILES:c1ccc2cc3c(cc2c1)C1=NC3=NC2=NC(=Nc3c4cc5ccccc5cc4c([n-]3)N=C3c4cc5ccccc5cc4C(=N3)[N-]1)c1cc3ccccc3cc21.Cl.Cl.[Sn]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Tin(IV) 2,3-Naphthalocyanine Dichloride
CAS:Formula:C48H24Cl2N8SnPurity:>95.0%(T)Color and Shape:Green to Dark green powder to crystalMolecular weight:902.39Tin(IV) 2,3-naphthalocyanine dichloride
CAS:<p>Tin(IV) 2,3-naphthalocyanine dichloride is a fine chemical that is a versatile building block for the synthesis of complex organic compounds. Tin(IV) 2,3-naphthalocyanine dichloride can be used in research and as a reagent or speciality chemical. This compound has high quality, useful for reaction component and scaffold in synthesis.</p>Formula:C48H24Cl2N8SnColor and Shape:PowderMolecular weight:902.37 g/molTin(IV) 2,3-naphthalocyanine Dichloride
CAS:Controlled Product<p>Applications Tin(IV) 2,3-naphthalocyanine dichloride is a useful dye for biological research purposes.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br></p>Formula:C21H25N7OColor and Shape:NeatMolecular weight:391.469



