CAS 2686-72-8
:4,6,7-trifluoro-1H-benzimidazole
Description:
4,6,7-Trifluoro-1H-benzimidazole is a heterocyclic organic compound characterized by the presence of a benzimidazole core substituted with three fluorine atoms at the 4, 6, and 7 positions. This compound typically exhibits a white to off-white crystalline appearance and is known for its stability under various conditions. The presence of fluorine atoms enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. It is soluble in polar organic solvents, which can facilitate its use in various chemical reactions and applications. The compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the fluorine substituents, potentially affecting its reactivity and interaction with biological targets. Additionally, 4,6,7-trifluoro-1H-benzimidazole may serve as a building block in the synthesis of more complex molecules, particularly in the development of agrochemicals and pharmaceuticals. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H3F3N2
InChI:InChI=1/C7H3F3N2/c8-3-1-4(9)6-7(5(3)10)12-2-11-6/h1-2H,(H,11,12)
InChI key:LKGYJXCGRGDDIA-UHFFFAOYSA-N
SMILES:c1c(c(c2c(c1F)nc[nH]2)F)F
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery