CAS 268731-07-3
:Fmoc-D-1,2,3,4-Tetrahydronorharman-3-carboxylic acid
Description:
Fmoc-D-1,2,3,4-Tetrahydronorharman-3-carboxylic acid is a chemical compound characterized by its structure, which includes a fluorene-derived Fmoc (9-fluorenylmethoxycarbonyl) protecting group and a tetrahydronorharman moiety. This compound is typically used in peptide synthesis and drug development due to its ability to serve as a building block for more complex molecules. The presence of the carboxylic acid functional group allows for further chemical modifications and conjugations, making it versatile in synthetic chemistry. Its tetrahydronorharman structure contributes to its potential biological activity, as compounds in this class are often investigated for their pharmacological properties. The Fmoc group is particularly useful in solid-phase peptide synthesis, as it can be easily removed under mild basic conditions, facilitating the sequential addition of amino acids. Overall, Fmoc-D-1,2,3,4-Tetrahydronorharman-3-carboxylic acid is a valuable compound in the field of medicinal chemistry and peptide research.
Formula:C27H22N2O4
InChI:InChI=1/C27H22N2O4/c30-26(31)25-13-21-20-11-5-6-12-23(20)28-24(21)14-29(25)27(32)33-15-22-18-9-3-1-7-16(18)17-8-2-4-10-19(17)22/h1-12,22,25,28H,13-15H2,(H,30,31)/t25-/m1/s1
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=O)N1Cc2c(C[C@@H]1C(=O)O)c1ccccc1[nH]2
Synonyms:- Fmoc-D-Tpi-OH
- (3R)-2-[(9H-fluoren-9-ylmethoxy)carbonyl]-2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(3R)-2-[(9H-fluoren-9-ylmethoxy)carbonyl]-1H,3H,4H,9H-pyrido[3,4-b]indole-3-carboxylic acid
CAS:Formula:C27H22N2O4Purity:98%Color and Shape:SolidMolecular weight:438.4746Fmoc-D-1,2,3,4-tetrahydronorharman-3-carboxylic acid
CAS:<p>Fmoc-D-1,2,3,4-tetrahydronorharman-3-carboxylic acid is a fine chemical that is a versatile building block and reaction intermediate. It is a high quality compound with CAS No. 268731-07-3. Fmoc-D-1,2,3,4-tetrahydronorharman-3-carboxylic acid can be used as a reagent for the synthesis of complex compounds and scaffolds. This compound has been shown to have useful properties in the research field.</p>Formula:C27H22N2O4Purity:Min. 95%Molecular weight:438.47 g/mol(3R)-2-[(9H-FLUOREN-9-YLMETHOXY)CARBONYL]-2,3,4,9-TETRAHYDRO-1H-β-CARBOLINE-3-CARBOXYLIC ACID
CAS:Purity:98%Molecular weight:438.4830017



