CAS 268733-18-2
:4-Bromo-3,5-bis(trifluoromethyl)aniline
Description:
4-Bromo-3,5-bis(trifluoromethyl)aniline is an organic compound characterized by the presence of a bromine atom and two trifluoromethyl groups attached to an aniline structure. Its molecular formula reflects the incorporation of these functional groups, contributing to its unique chemical properties. The bromine atom enhances the compound's reactivity, while the trifluoromethyl groups are known for their electron-withdrawing effects, which can influence the compound's acidity and nucleophilicity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or materials science, particularly in the synthesis of more complex molecules. Additionally, the presence of fluorine atoms often imparts desirable characteristics such as increased stability and lipophilicity. Safety considerations should be taken into account due to the potential toxicity associated with halogenated compounds. Overall, 4-Bromo-3,5-bis(trifluoromethyl)aniline is a notable compound in the realm of synthetic organic chemistry.
Formula:C8H4BrF6N
InChI:InChI=1/C8H4BrF6N/c9-6-4(7(10,11)12)1-3(16)2-5(6)8(13,14)15/h1-2H,16H2
SMILES:c1c(cc(c(c1C(F)(F)F)Br)C(F)(F)F)N
Synonyms:- Benzenamine, 4-bromo-3,5-bis(trifluoromethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromo-3,5-bis(trifluoromethyl)aniline
CAS:Formula:C8H4BrF6NPurity:98%Color and Shape:SolidMolecular weight:308.01854-Bromo-3,5-bis(trifluoromethyl)aniline
CAS:4-Bromo-3,5-bis(trifluoromethyl)anilinePurity:98%Molecular weight:308.02g/mol4-Bromo-3,5-bis(trifluoromethyl)aniline
CAS:Formula:C8H4BrF6NPurity:97%Color and Shape:SolidMolecular weight:308.0214-Bromo-3,5-bis(trifluoromethyl)aniline
CAS:4-Bromo-3,5-bis(trifluoromethyl)aniline is a chemical compound that belongs to the group of brominated compounds. It has high adsorption capacity for potassium and can be used as an adsorbent for gasification. 4-Bromo-3,5-bis(trifluoromethyl)aniline has been activated by carbons and catalysed with potassium to form an ionic complex with the carboxylic acid site on the surface of activated carbon. This process is used for purifying water or air from pollutants.
Formula:C8H4BrF6NPurity:Min. 95%Color and Shape:PowderMolecular weight:308.02 g/mol



