CymitQuimica logo

CAS 268734-27-6

:

Fmoc-L-Anthrylalanine

Description:
Fmoc-L-Anthrylalanine is a synthetic amino acid derivative characterized by the presence of a fluorenylmethoxycarbonyl (Fmoc) protective group and an anthracene moiety attached to the L-alanine backbone. This compound is primarily utilized in peptide synthesis and drug development due to its unique photophysical properties and ability to facilitate the study of protein interactions. The Fmoc group serves as a protective group for the amino group, allowing for selective coupling reactions during peptide synthesis. The anthracene component contributes to the compound's fluorescence, making it useful in various biochemical applications, including fluorescence microscopy and spectroscopy. Fmoc-L-Anthrylalanine is typically soluble in organic solvents and exhibits stability under standard laboratory conditions. Its structural features enable it to participate in π-π stacking interactions, which can influence the conformation and stability of peptides in which it is incorporated. Overall, Fmoc-L-Anthrylalanine is a valuable tool in the fields of medicinal chemistry and biochemistry for studying molecular interactions and developing novel therapeutic agents.
Formula:C32H25NO4
InChI:InChI=1S/C32H25NO4/c34-31(35)30(18-28-22-11-3-1-9-20(22)17-21-10-2-4-12-23(21)28)33-32(36)37-19-29-26-15-7-5-13-24(26)25-14-6-8-16-27(25)29/h1-17,29-30H,18-19H2,(H,33,36)(H,34,35)/t30-/m0/s1
InChI key:OGLRHZZGDZRSHK-PMERELPUSA-N
SMILES:C1=CC=C2C(=C1)C=C3C=CC=CC3=C2C[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46
Found 5 products.