CymitQuimica logo

CAS 268734-42-5

:

6-phenyl-1,2-benzisoxazol-3-amine

Description:
6-Phenyl-1,2-benzisoxazol-3-amine is a chemical compound characterized by its unique bicyclic structure, which includes a benzene ring fused to an isoxazole moiety. This compound features an amine functional group, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the phenyl group enhances its lipophilicity, which can influence its interaction with biological targets. This compound is of interest in medicinal chemistry and pharmacology due to its potential applications in drug development, particularly in the context of neuropharmacology and as a scaffold for synthesizing other bioactive molecules. Its molecular structure allows for various modifications, which can lead to derivatives with enhanced efficacy or selectivity for specific biological pathways. As with many organic compounds, safety and handling precautions should be observed, as its biological effects and toxicity profiles would need to be thoroughly evaluated in research settings.
Formula:C13H10N2O
InChI:InChI=1/C13H10N2O/c14-13-11-7-6-10(8-12(11)16-15-13)9-4-2-1-3-5-9/h1-8H,(H2,14,15)
InChI key:IIDSHOVHFQFLOR-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1ccc2c(c1)o[nH]c2=N
Synonyms:
  • 1,2-Benzisoxazol-3-Amine, 6-Phenyl-
  • 6-Phenyl-1,2-benzoxazol-3-amine
Found 4 products.