CAS 26889-39-4

2'-Amino-D-uridine

Description:

2'-Amino-D-uridine is a nucleoside analog of uridine, characterized by the presence of an amino group at the 2' position of the ribose sugar. This modification can influence its biological activity and interactions with nucleic acids. The compound is typically classified as a pyrimidine nucleoside, which plays a role in various biochemical processes, including RNA synthesis and metabolism. Its structural formula includes a ribose sugar linked to a uracil base, with the amino group contributing to its unique properties. 2'-Amino-D-uridine has been studied for its potential applications in antiviral therapies and as a research tool in molecular biology, particularly in the context of RNA-related studies. The compound's solubility, stability, and reactivity can vary depending on environmental conditions, such as pH and temperature. Additionally, its pharmacological profile may include effects on cellular processes, making it a subject of interest in medicinal chemistry and drug development. Overall, 2'-Amino-D-uridine represents a significant compound in the field of nucleoside chemistry with potential therapeutic implications.

Formula: C₉H₁₃N₃O₆

InChI: InChI=1/C9H13N3O6/c10-9(17)6(15)4(3-13)18-7(9)12-2-1-5(14)11-8(12)16/h1-2,4,6-7,13,15,17H,3,10H2,(H,11,14,16)/t4-,6-,7-,9-/m1/s1

SMILES: c1cn([C@H]2[C@]([C@@H]([C@@H](CO)O2)O)(N)O)c(=O)nc1O

Synonyms:

• 2'-NH2-dU
• 2'-Amino-2'-deoxyuridine

2′-Amino-2′-deoxyuridine

CAS: 26889-39-4

Formula: C₉H₁₃N₃O₅

Purity: 97%

Color and Shape: Liquid, No data available.

Molecular weight: 243.219

Ref: 10-F225623

Uridine, 2'-amino-2'-deoxy-

CAS: 26889-39-4

Formula: C₉H₁₃N₃O₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 243.2166

Ref: IN-DA00I536

2'-Amino-2'-deoxyuridine

CAS: 26889-39-4

2'-Amino-2'-deoxyuridine

Purity: 97%

Molecular weight: 243.22g/mol

Ref: 54-OR1006813

2''-Amino-2''-deoxyuridine

CAS: 26889-39-4

Formula: C₉H₁₃N₃O₅

Molecular weight: 243.22

Ref: 7W-GE3975

2'-Amino-2'-deoxyuridine

CAS: 26889-39-4

2'-Amino-2'-deoxyuridine is a modified nucleoside based on uridine. The 2'-hydroxyl group on the sugar is replaced by an amino group. This compound can be used for research purposes

Formula: C₉H₁₃N₃O₅

Purity: Min. 98 Area-%

Color and Shape: Powder

Molecular weight: 243.22 g/mol

Ref: 3D-NA05270

2'-Amino-2'-deoxyuridine

Controlled Product

CAS: 26889-39-4

Applications 2'-Amino-2'-deoxyuridine (cas# 26889-39-4) is a useful research chemical.

Formula: C₉H₁₃N₃O₅

Color and Shape: Neat

Molecular weight: 243.22

Ref: TR-A629293