CAS 26889-39-4
:2'-Amino-D-uridine
Description:
2'-Amino-D-uridine is a nucleoside analog of uridine, characterized by the presence of an amino group at the 2' position of the ribose sugar. This modification can influence its biological activity and interactions with nucleic acids. The compound is typically classified as a pyrimidine nucleoside, which plays a role in various biochemical processes, including RNA synthesis and metabolism. Its structural formula includes a ribose sugar linked to a uracil base, with the amino group contributing to its unique properties. 2'-Amino-D-uridine has been studied for its potential applications in antiviral therapies and as a research tool in molecular biology, particularly in the context of RNA-related studies. The compound's solubility, stability, and reactivity can vary depending on environmental conditions, such as pH and temperature. Additionally, its pharmacological profile may include effects on cellular processes, making it a subject of interest in medicinal chemistry and drug development. Overall, 2'-Amino-D-uridine represents a significant compound in the field of nucleoside chemistry with potential therapeutic implications.
Formula:C9H13N3O6
InChI:InChI=1/C9H13N3O6/c10-9(17)6(15)4(3-13)18-7(9)12-2-1-5(14)11-8(12)16/h1-2,4,6-7,13,15,17H,3,10H2,(H,11,14,16)/t4-,6-,7-,9-/m1/s1
SMILES:c1cn([C@H]2[C@]([C@@H]([C@@H](CO)O2)O)(N)O)c(=O)nc1O
Synonyms:- 2'-NH2-dU
- 2'-Amino-2'-deoxyuridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2′-Amino-2′-deoxyuridine
CAS:Formula:C9H13N3O5Purity:97%Color and Shape:Liquid, No data available.Molecular weight:243.219Uridine, 2'-amino-2'-deoxy-
CAS:Formula:C9H13N3O5Purity:97%Color and Shape:SolidMolecular weight:243.21662'-Amino-2'-deoxyuridine
CAS:2'-Amino-2'-deoxyuridine is a modified nucleoside based on uridine. The 2'-hydroxyl group on the sugar is replaced by an amino group. This compound can be used for research purposes
Formula:C9H13N3O5Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:243.22 g/mol2'-Amino-2'-deoxyuridine
CAS:Controlled ProductApplications 2'-Amino-2'-deoxyuridine (cas# 26889-39-4) is a useful research chemical.
Formula:C9H13N3O5Color and Shape:NeatMolecular weight:243.22






