CAS 26896-48-0
:Tricyclodecanedimethanol
Description:
Tricyclodecanedimethanol, with the CAS number 26896-48-0, is a bicyclic alcohol characterized by its unique structure, which features two hydroxymethyl groups attached to a tricyclic framework. This compound is typically a colorless, viscous liquid at room temperature and is known for its high boiling point and low volatility. It exhibits good solubility in organic solvents, while its solubility in water is limited due to its hydrophobic tricyclic structure. Tricyclodecanedimethanol is valued in various applications, particularly in the production of polyesters and as a plasticizer, owing to its ability to enhance flexibility and durability in polymer matrices. Additionally, it possesses favorable properties such as low toxicity and good thermal stability, making it suitable for use in consumer products and industrial applications. Its chemical stability and resistance to oxidation further contribute to its utility in formulations requiring long-lasting performance. Overall, tricyclodecanedimethanol is a versatile compound with significant relevance in materials science and chemical manufacturing.
Formula:C12H20O2
InChI:InChI=1/C12H20O2/c13-7-9-6-12-2-1-11(9,3-4-12)5-10(12)8-14/h9-10,13-14H,1-8H2
SMILES:C1CC23CCC1(CC3CO)C(C2)CO
Synonyms:- Tricyclodecanedimethanol
- 4,8-Bis(hydroxymethyl)tricyclo[5,2,1,02,6]decane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Tricyclo[5.2.1.02,6]decanedimethanol
CAS:Formula:C12H20O2Purity:>90.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:196.29Tricyclo[5.2.1.02,6]decanedimethanol
CAS:Formula:C12H20O2Purity:97%Color and Shape:LiquidMolecular weight:196.28604,8-Bis(hydroxymethyl)tricyclo[5.2.1.02,6]decane, mixture of isomers
CAS:4,8-Bis(hydroxymethyl)tricyclo[5.2.1.02,6]decane (bis-hydroxymethyl cyclodecane) is a chemical compound that has two hydroxyl groups and an aromatic ring. It is a cross-linking agent that can be used to increase the strength of cationic polymers by forming ester bonds with the polymer backbone. Bis-hydroxymethyl cyclodecane can be used to produce films with good thermal expansion properties, such as calcium hydrogencarbonate and sodium carbonate. This compound also has a wide range of applications as a substrate film in reactions and as a transport medium in chromatography columns. Bis-hydroxymethyl cyclodecane is also used as a solid catalyst for hydrogenating polycarboxylic acids to produce diols and polyols.
Formula:C12H20O2Purity:90%MinColor and Shape:Clear LiquidMolecular weight:196.29 g/mol




