CAS 26898-17-9
:Methylbis(phenylmethyl)benzene
Description:
Methylbis(phenylmethyl)benzene, also known by its CAS number 26898-17-9, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with two phenylmethyl groups and a methyl group. This compound typically exhibits a high degree of hydrophobicity due to its aromatic nature, making it less soluble in water but more soluble in organic solvents. It is likely to have a relatively high boiling point and melting point compared to simpler hydrocarbons, owing to the presence of multiple aromatic rings that enhance intermolecular interactions. Methylbis(phenylmethyl)benzene may be used in various applications, including as an intermediate in organic synthesis or in the formulation of specialty chemicals. Its chemical stability and resistance to oxidation are notable, which can be advantageous in certain industrial applications. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C21H20
InChI:InChI=1/C21H20/c1-4-10-18(11-5-1)16-21(20-14-8-3-9-15-20)17-19-12-6-2-7-13-19/h1-15,21H,16-17H2
SMILES:c1ccc(cc1)CC(Cc1ccccc1)c1ccccc1
Synonyms:- 1,1',1''-Propane-1,2,3-Triyltribenzene
- Barrel Therm 400
- Benzene, methylbis(phenylmethyl)-
- Bisbenzyltoluene
- Dibenzyl toluene
- Jarylec EXP 3
- Marlotherm S
- Methylbis(phenylmethyl)benzene
- Methyldibenzylbenzene
- Neo-Sk Oil 1400
- Therm-S 1000
- Toluene, ar,ar-dibenzyl-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Dibenzyltoluene
CAS:Dibenzyltoluene is a chemical compound that has been shown to be light-emitting. It is a cyclohexane derivative with a hydroxyl group, which allows the molecule to be membrane permeable and transport properties. Dibenzyltoluene reacts with p-hydroxybenzoic acid in the presence of an inorganic acid, such as hydrochloric acid or sulfuric acid, to form benzoic acid. This reaction mechanism can be applied to optimize the process for producing benzoic acid from dibenzyltoluene. Dibenzyltoluene may also be useful for treating tissue infection due to its high resistance and ability to inhibit bacterial growth with hydrogenation reactions.Formula:C21H20Color and Shape:Clear LiquidMolecular weight:272.38 g/mol

