CymitQuimica logo

CAS 269-12-5

:

2H-naphtho[2,3-d][1,2,3]triazole

Description:
2H-naphtho[2,3-d][1,2,3]triazole is a heterocyclic compound characterized by its fused naphthalene and triazole rings. This compound features a triazole moiety, which is a five-membered ring containing three nitrogen atoms, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific form. The presence of nitrogen in the triazole ring often imparts interesting reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, compounds like 2H-naphtho[2,3-d][1,2,3]triazole can exhibit biological activity, which has led to research into their potential applications in pharmaceuticals and agrochemicals. Its solubility can vary, and it may be soluble in organic solvents while being less soluble in water. Overall, this compound is of interest in both synthetic chemistry and materials science due to its structural features and potential applications.
Formula:C10H7N3
InChI:InChI=1/C10H7N3/c1-2-4-8-6-10-9(11-13-12-10)5-7(8)3-1/h1-6H,(H,11,12,13)
SMILES:c1ccc2cc3c(cc2c1)nn[nH]3
Synonyms:
  • 1H-naphtho[2,3-d]-1,2,3-triazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.