CAS 26903-26-4
:(2E)-1-(5-methylthiophen-2-yl)-3-phenylprop-2-en-1-one
Description:
The chemical substance known as (2E)-1-(5-methylthiophen-2-yl)-3-phenylprop-2-en-1-one, with the CAS number 26903-26-4, is an organic compound characterized by its conjugated double bond system and the presence of both thiophene and phenyl groups. This compound features a chalcone structure, which is typically known for its potential biological activities, including antioxidant and anti-inflammatory properties. The presence of the methylthio group enhances its lipophilicity, potentially influencing its interaction with biological membranes. The compound is likely to exhibit a yellow to orange color, typical of many chalcones, due to its extended π-conjugation. Its solubility may vary depending on the solvent, but it is generally more soluble in organic solvents than in water. The compound's reactivity can be attributed to the α,β-unsaturated carbonyl moiety, making it a candidate for various chemical reactions, including Michael additions and aldol condensations. Overall, this substance is of interest in both synthetic organic chemistry and medicinal chemistry for its diverse applications.
Formula:C14H12OS
InChI:InChI=1/C14H12OS/c1-11-7-10-14(16-11)13(15)9-8-12-5-3-2-4-6-12/h2-10H,1H3/b9-8+
Synonyms:- 1-(5-Methyl-2-thienyl)-3-phenyl-2-propen-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
NSC43067
CAS:<p>NSC43067 is a class of kinase inhibitors that are designed to inhibit the activity of cyclin-dependent kinases. Cyclin-dependent kinases are enzymes that regulate the progression of cells through the cell cycle by phosphorylating key substrates. NSC43067 binds to the ATP binding site of these enzymes and blocks their activity, thereby inhibiting cell division. This drug has been shown to be effective against some tumors and leukemia cells in vitro. In addition, it also has antiviral effects against HIV-1 protease and influenza virus neuraminidase.></p>Formula:C14H12OSPurity:Min. 95%Molecular weight:228.31 g/mol
