CAS 26903-85-5
:2,2-dimethoxy-1,2-thiasilolane
Description:
2,2-Dimethoxy-1,2-thiasilolane, identified by its CAS number 26903-85-5, is a chemical compound that belongs to the class of thiasilolanes, which are characterized by a sulfur atom incorporated into a cyclic structure. This compound features two methoxy groups attached to a saturated five-membered ring containing a sulfur atom. The presence of the methoxy groups contributes to its polar characteristics, potentially influencing its solubility in various solvents. Thiasilolanes are often studied for their potential applications in organic synthesis and as intermediates in the production of pharmaceuticals and agrochemicals. The compound may exhibit interesting reactivity due to the sulfur atom, which can participate in various chemical reactions, including nucleophilic substitutions and redox processes. Additionally, the structural features of 2,2-dimethoxy-1,2-thiasilolane may impart unique physical properties, such as boiling and melting points, which are essential for understanding its behavior in different chemical environments. However, specific data on its toxicity, stability, and reactivity should be consulted from reliable sources for safe handling and application.
Formula:C5H12O2SSi
InChI:InChI=1/C5H12O2SSi/c1-6-9(7-2)5-3-4-8-9/h3-5H2,1-2H3
SMILES:CO[Si]1(CCCS1)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,2-Dimethoxy-1-thia-2-silacyclopentane
CAS:<p>S25140 - 2,2-Dimethoxy-1-thia-2-silacyclopentane</p>Formula:C5H12O2SSiColor and Shape:LiquidMolecular weight:164.29
