CAS 26905-40-8
:magnesium chloride (3-methoxyphenyl)methanide (1:1:1)
Description:
Magnesium chloride (3-methoxyphenyl)methanide (1:1:1), with the CAS number 26905-40-8, is a chemical compound that features a coordination complex involving magnesium and an organic ligand derived from 3-methoxyphenylmethanide. This substance typically exhibits characteristics common to magnesium salts, such as being hygroscopic and soluble in polar solvents. The presence of the 3-methoxyphenyl group may impart unique properties, including potential applications in organic synthesis or as a catalyst in various chemical reactions. The compound's structure suggests it may participate in coordination chemistry, forming complexes that could be relevant in fields like materials science or medicinal chemistry. Additionally, the methoxy group can influence the electronic properties of the molecule, potentially affecting its reactivity and interactions with other chemical species. As with many magnesium compounds, it is important to handle this substance with care, considering its reactivity and the potential for moisture absorption.
Formula:C8H9ClMgO
InChI:InChI=1/C8H9O.ClH.Mg/c1-7-4-3-5-8(6-7)9-2;;/h3-6H,1H2,2H3;1H;/q-1;;+2/p-1
SMILES:C=C1C=CC=C([CH-]1)OC.Cl.[Mg]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.