CAS 269062-80-8
:Fmoc-Orn(Dde)-OH
Description:
Fmoc-Orn(Dde)-OH, with the CAS number 269062-80-8, is a chemical compound commonly used in peptide synthesis and research. It is a derivative of ornithine, an amino acid, and features a 9-fluorenylmethoxycarbonyl (Fmoc) protecting group, which is widely utilized in solid-phase peptide synthesis due to its stability and ease of removal under mild conditions. The compound also contains a Dde (N, N-dimethyl-2,4-dinitrophenyl) protecting group on the side chain, which is typically used to protect amino groups during synthesis. This dual protection allows for selective deprotection steps, facilitating the assembly of complex peptides. Fmoc-Orn(Dde)-OH is characterized by its solid-state form, stability under standard laboratory conditions, and solubility in organic solvents, making it suitable for various synthetic applications. Its structure allows for the introduction of ornithine residues into peptides, which can be crucial for biological activity and function. Overall, Fmoc-Orn(Dde)-OH is an important building block in the field of peptide chemistry.
Formula:C30H34N2O6
InChI:InChI=1/C30H34N2O6/c1-18(27-25(33)15-30(2,3)16-26(27)34)31-14-8-13-24(28(35)36)32-29(37)38-17-23-21-11-6-4-9-19(21)20-10-5-7-12-22(20)23/h4-7,9-12,23-24,31H,8,13-17H2,1-3H3,(H,32,37)(H,35,36)/t24-/m0/s1
SMILES:CC(=C1C(=O)CC(C)(C)CC1=O)NCCC[C@@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Fmoc-Orn(Dde)-OH
CAS:The Nδ-protecting group Dde is orthogonal to both Fmoc and Boc which allows on-resin modification of ornithine side chains during Fmoc/tBu-based SPPS. The applications of Dde side-chain protection include synthesis of branched or di-epitopic peptides, preparation of MAP core molecules and lipo-MAPS, the synthesis of cyclic peptides, TASP molecules, and templates for combinatorial chemistry and synthetic proteins. Dde can be cleaved by 2% hydrazine in DMF.Formula:C30H34N2O6Purity:99.6%Color and Shape:WhitishMolecular weight:518.61Fmoc-(Nd-1-(4,4-dimethyl-2,6-dioxo-cyclohex-1-ylidene)ethyl)-L-ornithine
CAS:Formula:C30H34N2O6Purity:95%Color and Shape:SolidMolecular weight:518.6008(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-((1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl)amino)pentanoic acid
CAS:(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-((1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl)amino)pentanoic acidPurity:95%Molecular weight:518.60g/molFmoc-Orn(Dde)-OH
CAS:M06258 - Fmoc-Orn(Dde)-OH
Formula:C30H34N2O6Purity:95%Color and Shape:SolidMolecular weight:518.61




